N-(1-Hydroxy-3-{4-[4-(2-oxo-3,4-dihydro-2H-quinolin-1-yl)-piperidine-1-carbonyl]-phenoxy}-propyl)-acetamide

ID: ALA42432

PubChem CID: 15285180

Max Phase: Preclinical

Molecular Formula: C26H31N3O5

Molecular Weight: 465.55

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)NC(O)CCOc1ccc(C(=O)N2CCC(N3C(=O)CCc4ccccc43)CC2)cc1

Standard InChI:  InChI=1S/C26H31N3O5/c1-18(30)27-24(31)14-17-34-22-9-6-20(7-10-22)26(33)28-15-12-21(13-16-28)29-23-5-3-2-4-19(23)8-11-25(29)32/h2-7,9-10,21,24,31H,8,11-17H2,1H3,(H,27,30)

Standard InChI Key:  MIWKBPHMEDNABW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    0.6792    1.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6625   -2.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6667   -1.3667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4042    1.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0375    1.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6792    0.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9167   -6.3500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9167   -7.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3750   -2.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0375   -0.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3917   -0.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3875   -0.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0458   -0.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0333    2.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0583   -2.6042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2042   -5.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4042    2.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1167    1.0958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2125   -5.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2000   -7.5792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6792    2.7708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3625   -3.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0792   -2.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7917   -3.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5000   -4.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0667   -3.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7917   -2.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4917   -6.3417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5042   -3.8667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500    1.1083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6292   -7.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500    2.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4625    1.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4625    2.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3 12  1  0
  4  1  1  0
  5  1  1  0
  6  1  1  0
  7 16  1  0
  8  7  1  0
  9  2  1  0
 10  6  1  0
 11  6  1  0
 12 11  1  0
 13 10  1  0
 14  5  1  0
 15  2  2  0
 16 19  1  0
 17  4  1  0
 18  4  2  0
 19 25  1  0
 20  8  2  0
 21 14  1  0
 22  9  2  0
 23  9  1  0
 24 27  1  0
 25 29  1  0
 26 22  1  0
 27 23  2  0
 28 16  1  0
 29 24  1  0
 30  5  2  0
 31  8  1  0
 32 14  2  0
 33 30  1  0
 34 33  2  0
  3 13  1  0
 21 17  1  0
 34 32  1  0
 24 26  2  0
M  END

Associated Targets(Human)

AVPR1A Tclin Vasopressin V1 receptor (61 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 465.55Molecular Weight (Monoisotopic): 465.2264AlogP: 2.49#Rotatable Bonds: 7
Polar Surface Area: 99.18Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.59CX Basic pKa: CX LogP: 1.26CX LogD: 1.26
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.61Np Likeness Score: -0.77

References

1. Otsubo K, Morita S, Uchida M.  (1993)  Synthesis of N-Acetylhemiaminal metabolites of opc-21268, vasopressin V1 receptor antagonist,  (8): [10.1016/S0960-894X(00)80032-3]

Source