The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-Methoxy-5-(4-(3-morpholinopropyl)-3-oxo-3,4-dihydro-2Hbenzo[b][1,4]oxazin-6-yl)pyridin-3-yl)butane-1-sulfonamide ID: ALA4243592
PubChem CID: 145985745
Max Phase: Preclinical
Molecular Formula: C25H34N4O6S
Molecular Weight: 518.64
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCS(=O)(=O)Nc1cc(-c2ccc3c(c2)N(CCCN2CCOCC2)C(=O)CO3)cnc1OC
Standard InChI: InChI=1S/C25H34N4O6S/c1-3-4-14-36(31,32)27-21-15-20(17-26-25(21)33-2)19-6-7-23-22(16-19)29(24(30)18-35-23)9-5-8-28-10-12-34-13-11-28/h6-7,15-17,27H,3-5,8-14,18H2,1-2H3
Standard InChI Key: CNRXITRFSNGXMS-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
11.1476 -4.1561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5604 -3.4504 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.7428 -3.4458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5645 -5.0889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5645 -5.9061 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2698 -6.3105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9751 -5.9061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9751 -5.0889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2698 -4.6762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6817 -6.3191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6786 -7.1372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3816 -7.5467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3879 -5.9105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0955 -6.3245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0888 -7.1444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7916 -7.5577 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5055 -7.1558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5121 -6.3360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8049 -5.9181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2235 -5.9338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2698 -3.8590 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8556 -4.6824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1491 -5.0930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8103 -5.1009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5562 -2.6332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2619 -2.2210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2577 -1.4038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9634 -0.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5208 -4.6970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5262 -3.8799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2367 -3.4760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9437 -3.8946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6520 -3.4942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6617 -2.6767 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9570 -2.2612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2425 -2.6632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 9 2 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
10 11 1 0
10 13 2 0
11 12 2 0
12 15 1 0
14 13 1 0
7 10 1 0
14 15 2 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
9 21 1 0
21 2 1 0
4 22 1 0
22 23 1 0
19 24 1 0
2 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
24 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
31 36 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 518.64Molecular Weight (Monoisotopic): 518.2199AlogP: 2.75#Rotatable Bonds: 11Polar Surface Area: 110.30Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.91CX Basic pKa: 6.65CX LogP: 0.98CX LogD: 1.01Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.48Np Likeness Score: -1.68
References 1. Dong FD, Liu DD, Deng CL, Qin XC, Chen K, Wang J, Song HR, Ding HW.. (2018) Design, synthesis and biological evaluation of novel series of 2H-benzo[b][1,4]oxazin-3(4H)-one and 2H-benzo[b][1,4]oxazine scaffold derivatives as PI3Kα inhibitors., 26 (14): [PMID:29937355 ] [10.1016/j.bmc.2018.06.022 ]