5-Ethyl-3'-methyl-4-[6-methyl-6-(1H-tetrazol-5-yl)-heptyloxy]-biphenyl-2-ol

ID: ALA424361

PubChem CID: 9845587

Max Phase: Preclinical

Molecular Formula: C24H32N4O2

Molecular Weight: 408.55

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCc1cc(-c2cccc(C)c2)c(O)cc1OCCCCCC(C)(C)c1nn[nH]n1

Standard InChI:  InChI=1S/C24H32N4O2/c1-5-18-15-20(19-11-9-10-17(2)14-19)21(29)16-22(18)30-13-8-6-7-12-24(3,4)23-25-27-28-26-23/h9-11,14-16,29H,5-8,12-13H2,1-4H3,(H,25,26,27,28)

Standard InChI Key:  NLWXFZITBNGDOQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    9.2250   -3.0167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2750   -3.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9167   -2.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8250   -3.4667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3375   -2.6250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0792   -2.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5917   -2.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0792   -3.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1167   -2.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5542   -2.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1167   -3.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5917   -3.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7542   -3.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0417   -2.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5917   -1.7292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5250   -2.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6375   -3.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5625   -1.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0417   -1.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5917   -4.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2375   -3.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0542   -4.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4542   -4.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5167   -1.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1542   -3.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0042   -2.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7167   -3.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6792   -3.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1917   -3.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1167   -4.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  4  2  0
  3  1  1  0
  4  1  1  0
  5  3  2  0
  6  8  2  0
  7  9  2  0
  8 12  1  0
  9 11  1  0
 10  6  1  0
 11 17  1  0
 12 11  2  0
 13  2  1  0
 14 10  1  0
 15  7  1  0
 16 14  2  0
 17 25  1  0
 18 10  2  0
 19 18  1  0
 20 12  1  0
 21 13  1  0
 22 13  1  0
 23 13  1  0
 24 19  2  0
 25 28  1  0
 26 16  1  0
 27 21  1  0
 28 29  1  0
 29 27  1  0
 30 20  1  0
  5  2  1  0
  7  6  1  0
 16 24  1  0
M  END

Associated Targets(Human)

LTB4R2 Tchem Leukotriene B4 receptor (773 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
LTB4R Tchem Leukotriene B4 receptor 1 (1083 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 408.55Molecular Weight (Monoisotopic): 408.2525AlogP: 5.36#Rotatable Bonds: 10
Polar Surface Area: 83.92Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 5.78CX Basic pKa: CX LogP: 7.25CX LogD: 5.95
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.44Np Likeness Score: -0.45

References

1. Sawyer JS, Bach NJ, Baker SR, Baldwin RF, Borromeo PS, Cockerham SL, Fleisch JH, Floreancig P, Froelich LL, Jackson WT..  (1995)  Synthetic and structure/activity studies on acid-substituted 2-arylphenols: discovery of 2-[2-propyl-3-[3-[2-ethyl-4-(4-fluorophenyl)-5- hydroxyphenoxy]-propoxy]phenoxy]benzoic acid, a high-affinity leukotriene B4 receptor antagonist.,  38  (22): [PMID:7473568] [10.1021/jm00022a006]
2. Wikel JH, Sofia MJ, Saussy DL, Bemis KG.  (1994)  QSAR Study of ortho-phenylphenol leukotriene B4 receptor antagonists,  (6): [10.1016/S0960-894X(01)80850-7]

Source