N-(1-(4-methoxyphenylsulfonyl)piperidin-4-yl)-5-methylpyridin-2-amine

ID: ALA4243675

PubChem CID: 145983054

Max Phase: Preclinical

Molecular Formula: C18H23N3O3S

Molecular Weight: 361.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(S(=O)(=O)N2CCC(Nc3ccc(C)cn3)CC2)cc1

Standard InChI:  InChI=1S/C18H23N3O3S/c1-14-3-8-18(19-13-14)20-15-9-11-21(12-10-15)25(22,23)17-6-4-16(24-2)5-7-17/h3-8,13,15H,9-12H2,1-2H3,(H,19,20)

Standard InChI Key:  DBDWRJAVJIRQIT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   14.3324  -15.0148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3313  -15.8344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0393  -16.2433    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7490  -15.8339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7462  -15.0112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0376  -14.6060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4574  -16.2414    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1644  -15.8317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8711  -16.2448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5761  -15.8385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5790  -15.0210    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8708  -14.6113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1597  -15.0192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2876  -14.6140    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   19.9944  -15.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8738  -13.9005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.6910  -13.9005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.9877  -15.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6937  -16.2514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4033  -15.8444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4025  -15.0229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6959  -14.6166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1106  -16.2536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.1099  -17.0708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6246  -14.6064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 11 14  1  0
 14 15  1  0
 14 16  2  0
 14 17  2  0
 15 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 15  1  0
 20 23  1  0
 23 24  1  0
  1 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4243675

    ---

Associated Targets(Human)

CCR6 Tchem C-C chemokine receptor type 6 (388 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 361.47Molecular Weight (Monoisotopic): 361.1460AlogP: 2.66#Rotatable Bonds: 5
Polar Surface Area: 71.53Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.99CX LogP: 2.04CX LogD: 1.90
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.89Np Likeness Score: -1.88

References

1. Tawaraishi T, Sakauchi N, Hidaka K, Yoshikawa K, Okui T, Kuno H, Chisaki I, Aso K..  (2018)  Identification of a novel series of potent and selective CCR6 inhibitors as biological probes.,  28  (18): [PMID:30098865] [10.1016/j.bmcl.2018.07.042]
2. Tawaraishi, Taisuke T and 7 more authors.  2018-10-01  Identification of a novel series of potent and selective CCR6 inhibitors as biological probes.  [PMID:30098865]

Source