The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-(2-(4-(chloromethyl)benzamido)acetamido)-3-(4-hydroxyphenethylamino)-3-oxopropyl dihydrogen phosphate ID: ALA4243744
PubChem CID: 145984025
Max Phase: Preclinical
Molecular Formula: C21H25ClN3O8P
Molecular Weight: 513.87
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CNC(=O)c1ccc(CCl)cc1)N[C@@H](COP(=O)(O)O)C(=O)NCCc1ccc(O)cc1
Standard InChI: InChI=1S/C21H25ClN3O8P/c22-11-15-1-5-16(6-2-15)20(28)24-12-19(27)25-18(13-33-34(30,31)32)21(29)23-10-9-14-3-7-17(26)8-4-14/h1-8,18,26H,9-13H2,(H,23,29)(H,24,28)(H,25,27)(H2,30,31,32)/t18-/m0/s1
Standard InChI Key: POWSFNHJMAGOFQ-SFHVURJKSA-N
Molfile:
RDKit 2D
34 35 0 0 0 0 0 0 0 0999 V2000
31.1317 -3.1243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8394 -2.7157 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.4240 -2.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1317 -3.9415 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.7163 -3.1243 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.0086 -2.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3009 -3.1243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0086 -1.8985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5938 -2.7124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8866 -3.1203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8862 -3.9384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5988 -4.3468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3031 -3.9366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5471 -3.1243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2548 -2.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5471 -3.9415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9625 -3.1243 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.2548 -1.8985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.2548 -4.3501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.2548 -5.1673 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
33.9625 -5.5759 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.5471 -5.5759 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.9588 -4.7504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.6702 -2.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3779 -3.1243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0856 -2.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7923 -3.1283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4995 -2.7204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4999 -1.9024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7872 -1.4939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0829 -1.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2071 -1.4928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.1790 -4.3479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4707 -3.9403 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
3 5 1 0
5 6 1 0
6 7 1 0
6 8 2 0
7 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 7 1 0
2 14 1 0
14 15 1 0
14 16 1 6
15 17 1 0
15 18 2 0
16 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
20 23 1 0
17 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
29 32 1 0
11 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 513.87Molecular Weight (Monoisotopic): 513.1068AlogP: 0.81#Rotatable Bonds: 12Polar Surface Area: 174.29Molecular Species: ACIDHBA: 6HBD: 6#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 1.36CX Basic pKa: ┄CX LogP: 0.53CX LogD: -2.88Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.18Np Likeness Score: -0.27
References 1. Stevers LM, Sijbesma E, Botta M, MacKintosh C, Obsil T, Landrieu I, Cau Y, Wilson AJ, Karawajczyk A, Eickhoff J, Davis J, Hann M, O'Mahony G, Doveston RG, Brunsveld L, Ottmann C.. (2018) Modulators of 14-3-3 Protein-Protein Interactions., 61 (9): [PMID:28968506 ] [10.1021/acs.jmedchem.7b00574 ]