(E)-3-(3,4-dimethoxyphenyl)-1-(4-(4-(quinolin-8-yloxy)butoxy)phenyl)prop-2-en-1-one

ID: ALA4243950

PubChem CID: 129885731

Max Phase: Preclinical

Molecular Formula: C30H29NO5

Molecular Weight: 483.56

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(/C=C/C(=O)c2ccc(OCCCCOc3cccc4cccnc34)cc2)cc1OC

Standard InChI:  InChI=1S/C30H29NO5/c1-33-27-17-11-22(21-29(27)34-2)10-16-26(32)23-12-14-25(15-13-23)35-19-3-4-20-36-28-9-5-7-24-8-6-18-31-30(24)28/h5-18,21H,3-4,19-20H2,1-2H3/b16-10+

Standard InChI Key:  BNBDLNHVZQMWMB-MHWRWJLKSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    9.4483   -2.5086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4472   -3.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1552   -3.7371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8649   -3.3277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8620   -2.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1534   -2.0998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5682   -2.0938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2774   -2.4997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5651   -1.2766    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9836   -2.0884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6929   -2.4944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6928   -3.3104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4012   -3.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1084   -3.3050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1027   -2.4835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3937   -2.0814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8182   -3.7099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.8223   -4.5271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8074   -2.0698    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5180   -2.4732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7391   -3.7362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0317   -3.3270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9122   -3.7351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6202   -3.3270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3276   -3.7362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2042   -3.3270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2035   -2.5098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9123   -2.1020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9120   -1.2856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2035   -0.8767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4975   -2.1053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4955   -1.2864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7864   -0.8805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0788   -1.2924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0848   -2.1144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7945   -2.5167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 14 17  1  0
 17 18  1  0
 15 19  1  0
 19 20  1  0
  2 21  1  0
 21 22  1  0
 23 24  1  0
 24 25  1  0
 25 22  1  0
 23 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 32  1  0
 31 27  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 31  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4243950

    ---

Associated Targets(non-human)

Leishmania panamensis (230 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 483.56Molecular Weight (Monoisotopic): 483.2046AlogP: 6.39#Rotatable Bonds: 12
Polar Surface Area: 66.88Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 2.87CX LogP: 5.80CX LogD: 5.80
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.13Np Likeness Score: -0.47

References

1. de Mello MVP, Abrahim-Vieira BA, Domingos TFS, de Jesus JB, de Sousa ACC, Rodrigues CR, Souza AMT..  (2018)  A comprehensive review of chalcone derivatives as antileishmanial agents.,  150  [PMID:29602038] [10.1016/j.ejmech.2018.03.047]

Source