The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-morpholinophenyl)-6-(quinolin-4-yl)quinazolin-4(3H)-one ID: ALA4244382
PubChem CID: 133107911
Max Phase: Preclinical
Molecular Formula: C27H22N4O2
Molecular Weight: 434.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=c1c2cc(-c3ccnc4ccccc34)ccc2ncn1-c1ccc(N2CCOCC2)cc1
Standard InChI: InChI=1S/C27H22N4O2/c32-27-24-17-19(22-11-12-28-25-4-2-1-3-23(22)25)5-10-26(24)29-18-31(27)21-8-6-20(7-9-21)30-13-15-33-16-14-30/h1-12,17-18H,13-16H2
Standard InChI Key: MTDJGYWCNQTZLJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 38 0 0 0 0 0 0 0 0999 V2000
21.4531 -15.3353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1627 -14.9259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1599 -14.1032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4513 -13.6980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7450 -14.9264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7491 -14.1068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0453 -13.6957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3329 -14.0997 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.3288 -14.9193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0371 -15.3349 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0506 -12.8786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8661 -13.6919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2757 -12.8722 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.5615 -12.4665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8587 -12.8794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2783 -13.6903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5759 -14.0984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5791 -14.9089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2840 -15.3123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9872 -14.8992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9805 -14.0900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6278 -13.6866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6375 -12.8690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9333 -12.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2220 -12.8601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2193 -13.6815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9242 -14.0909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5163 -12.4479 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5261 -11.6300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8245 -11.2180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1123 -11.6195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1062 -12.4376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8123 -12.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
7 11 2 0
3 12 1 0
12 17 2 0
16 13 2 0
13 14 1 0
14 15 2 0
15 12 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
8 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
28 29 1 0
28 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 434.50Molecular Weight (Monoisotopic): 434.1743AlogP: 4.44#Rotatable Bonds: 3Polar Surface Area: 60.25Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.51CX LogP: 4.30CX LogD: 4.30Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.42Np Likeness Score: -1.00
References 1. Hudson L, Mui J, Vázquez S, Carvalho DM, Williams E, Jones C, Bullock AN, Hoelder S.. (2018) Novel Quinazolinone Inhibitors of ALK2 Flip between Alternate Binding Modes: Structure-Activity Relationship, Structural Characterization, Kinase Profiling, and Cellular Proof of Concept., 61 (16): [PMID:30085668 ] [10.1021/acs.jmedchem.8b00782 ]