(E)-15-(N-4-Biphenyl)sophoridinic imine

ID: ALA4244448

PubChem CID: 145985974

Max Phase: Preclinical

Molecular Formula: C27H33N3

Molecular Weight: 399.58

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  c1ccc(-c2ccc(/N=C3\CCC[C@@H]4[C@H]5CCCN6CCC[C@H](CN34)[C@@H]56)cc2)cc1

Standard InChI:  InChI=1S/C27H33N3/c1-2-7-20(8-3-1)21-13-15-23(16-14-21)28-26-12-4-11-25-24-10-6-18-29-17-5-9-22(27(24)29)19-30(25)26/h1-3,7-8,13-16,22,24-25,27H,4-6,9-12,17-19H2/b28-26+/t22-,24-,25-,27+/m1/s1

Standard InChI Key:  MPXZDKAUABMFJK-VCJXSUFBSA-N

Molfile:  

     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
    1.3207  -25.2297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3207  -26.0469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0260  -26.4514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7278  -26.0469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4299  -26.4562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1399  -26.0529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1434  -25.2357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0260  -24.8170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7295  -25.2327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4373  -24.8336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0303  -24.0021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7443  -23.6014    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4502  -24.0205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1621  -23.6210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1745  -22.8008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4687  -22.3817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7505  -22.7827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0473  -22.3664    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7240  -24.4126    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4297  -25.6507    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1520  -24.4291    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0182  -25.6342    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0562  -21.5493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7701  -21.1515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7793  -20.3352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0756  -19.9181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3611  -20.3233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3553  -21.1383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0836  -19.1015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7968  -18.7003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8049  -17.8839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1006  -17.4677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3867  -17.8739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3820  -18.6889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  8  1  0
  2  3  1  0
  3  4  1  0
  9  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7 10  1  0
  8  9  1  0
  8 11  1  0
  9 10  1  0
 10 13  1  0
 12 11  1  0
 12 13  1  0
 12 17  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
  9 19  1  6
 10 20  1  6
 13 21  1  1
  8 22  1  1
 18 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 26 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4244448

    ---

Associated Targets(Human)

HepG2 (196354 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HeLa (62764 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Topoisomerase I (119 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 399.58Molecular Weight (Monoisotopic): 399.2674AlogP: 5.74#Rotatable Bonds: 2
Polar Surface Area: 18.84Molecular Species: BASEHBA: 2HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.89CX LogP: 4.93CX LogD: 2.66
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.64Np Likeness Score: 0.29

References

1. Xu Y, Jing D, Chen R, Rashid HU, Jiang J, Liu X, Wang L, Xie P..  (2018)  Design, synthesis and evaluation of novel sophoridinic imine derivatives containing conjugated planar structure as potent anticancer agents.,  26  (14): [PMID:30007563] [10.1016/j.bmc.2018.07.001]

Source