The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-15-(N-4-Biphenyl)sophoridinic imine ID: ALA4244448
PubChem CID: 145985974
Max Phase: Preclinical
Molecular Formula: C27H33N3
Molecular Weight: 399.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: c1ccc(-c2ccc(/N=C3\CCC[C@@H]4[C@H]5CCCN6CCC[C@H](CN34)[C@@H]56)cc2)cc1
Standard InChI: InChI=1S/C27H33N3/c1-2-7-20(8-3-1)21-13-15-23(16-14-21)28-26-12-4-11-25-24-10-6-18-29-17-5-9-22(27(24)29)19-30(25)26/h1-3,7-8,13-16,22,24-25,27H,4-6,9-12,17-19H2/b28-26+/t22-,24-,25-,27+/m1/s1
Standard InChI Key: MPXZDKAUABMFJK-VCJXSUFBSA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
1.3207 -25.2297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3207 -26.0469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0260 -26.4514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7278 -26.0469 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4299 -26.4562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1399 -26.0529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1434 -25.2357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0260 -24.8170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7295 -25.2327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4373 -24.8336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0303 -24.0021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7443 -23.6014 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4502 -24.0205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1621 -23.6210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1745 -22.8008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4687 -22.3817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7505 -22.7827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0473 -22.3664 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7240 -24.4126 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.4297 -25.6507 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.1520 -24.4291 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.0182 -25.6342 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.0562 -21.5493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7701 -21.1515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7793 -20.3352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0756 -19.9181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3611 -20.3233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3553 -21.1383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0836 -19.1015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7968 -18.7003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8049 -17.8839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1006 -17.4677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3867 -17.8739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3820 -18.6889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 8 1 0
2 3 1 0
3 4 1 0
9 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 10 1 0
8 9 1 0
8 11 1 0
9 10 1 0
10 13 1 0
12 11 1 0
12 13 1 0
12 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
9 19 1 6
10 20 1 6
13 21 1 1
8 22 1 1
18 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
26 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 399.58Molecular Weight (Monoisotopic): 399.2674AlogP: 5.74#Rotatable Bonds: 2Polar Surface Area: 18.84Molecular Species: BASEHBA: 2HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.89CX LogP: 4.93CX LogD: 2.66Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.64Np Likeness Score: 0.29
References 1. Xu Y, Jing D, Chen R, Rashid HU, Jiang J, Liu X, Wang L, Xie P.. (2018) Design, synthesis and evaluation of novel sophoridinic imine derivatives containing conjugated planar structure as potent anticancer agents., 26 (14): [PMID:30007563 ] [10.1016/j.bmc.2018.07.001 ]