NA

ID: ALA4244884

PubChem CID: 145983558

Max Phase: Preclinical

Molecular Formula: C36H51NO3

Molecular Weight: 545.81

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(C)CCC[C@](C)([C@H]2CC[C@]3(C)[C@@H]2[C@H](O)C[C@@H]2[C@@]4(C)Cc5c([nH]c6ccccc56)C(C)(C)[C@@H]4C(=O)C[C@]23C)O1

Standard InChI:  InChI=1S/C36H51NO3/c1-31(2)15-11-16-36(8,40-31)23-14-17-34(6)28(23)25(38)18-27-33(5)19-22-21-12-9-10-13-24(21)37-30(22)32(3,4)29(33)26(39)20-35(27,34)7/h9-10,12-13,23,25,27-29,37-38H,11,14-20H2,1-8H3/t23-,25+,27+,28-,29-,33+,34+,35+,36+/m0/s1

Standard InChI Key:  RYPLJABMUJCZDP-ZUVMCECZSA-N

Molfile:  

     RDKit          2D

 44 50  0  0  0  0  0  0  0  0999 V2000
    3.6815  -25.7704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6856  -24.9491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9717  -25.3541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5829  -19.6828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2969  -20.0955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2959  -19.2723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6893  -23.3065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3987  -23.7192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3952  -24.5405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1014  -24.9539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8155  -24.5465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1083  -23.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8152  -23.7277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8319  -22.0888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1136  -22.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5346  -22.5093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5257  -23.3272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3011  -23.5871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7908  -22.9298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3154  -22.2663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5796  -21.4911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3862  -21.3275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6478  -20.5530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1065  -19.9368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0347  -20.8761    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3872  -25.3577    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3914  -22.8979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1013  -24.1319    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0968  -25.7752    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8070  -22.9061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8419  -21.2675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5210  -24.1484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5293  -21.6845    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1348  -22.2623    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.2875  -21.8991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9799  -24.5405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9753  -23.7192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2002  -24.7985    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7137  -24.1368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1936  -23.4753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8605  -22.7311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0478  -22.6472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5693  -23.3136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9051  -24.0551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  1  0
  6  5  1  0
 37  7  1  0
 36  2  1  0
  2  9  1  0
  8  7  1  0
  8  9  1  0
  8 12  1  0
  9 10  1  0
 10 11  1  0
 11 13  1  0
 12 13  1  0
 12 15  1  0
 13 17  1  0
 16 14  1  0
 14 15  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 16  1  0
 21 22  1  0
 21 25  1  0
 22 23  1  0
 23 24  1  0
 24  5  1  0
  5 25  1  0
 20 21  1  0
  9 26  1  6
  8 27  1  1
 12 28  1  6
 10 29  2  0
 13 30  1  1
 14 31  1  1
 17 32  1  6
 16 33  1  1
 20 34  1  6
 21 35  1  1
 36 37  2  0
 37 40  1  0
 39 38  1  0
 38 36  1  0
 39 40  2  0
 40 41  1  0
 41 42  2  0
 42 43  1  0
 43 44  2  0
 44 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4244884

    ---

Associated Targets(Human)

ATP1A1 Tclin Sodium/potassium-transporting ATPase (386 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 545.81Molecular Weight (Monoisotopic): 545.3869AlogP: 7.75#Rotatable Bonds: 1
Polar Surface Area: 62.32Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 6.71CX LogD: 6.71
Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.38Np Likeness Score: 2.27

References

1. Wu Q, Chen P, Tu G, Li M, Pan B, Guo Y, Zhai J, Fu H..  (2018)  Synthesis and evaluation of panaxatriol derivatives as Na+, K+-ATPase inhibitors.,  28  (17): [PMID:30049579] [10.1016/j.bmcl.2018.07.027]
2. Wu Q, Wang R, Shi Y, Li W, Li M, Chen P, Pan B, Wang Q, Li C, Wang J, Sun G, Sun X, Fu H..  (2020)  Synthesis and biological evaluation of panaxatriol derivatives against myocardial ischemia/reperfusion injury in the rat.,  185  [PMID:31655431] [10.1016/j.ejmech.2019.111729]

Source