(S)-3-(3-(4H-1,2,4-Triazol-4-yl)phenyl)-4-((R)-3-(2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl)pyrrolidin-1-yl)-butanoic Acid

ID: ALA4246111

PubChem CID: 121246911

Max Phase: Preclinical

Molecular Formula: C26H32N6O2

Molecular Weight: 460.58

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)C[C@H](CN1CC[C@@H](CCc2ccc3c(n2)NCCC3)C1)c1cccc(-n2cnnc2)c1

Standard InChI:  InChI=1S/C26H32N6O2/c33-25(34)14-22(21-3-1-5-24(13-21)32-17-28-29-18-32)16-31-12-10-19(15-31)6-8-23-9-7-20-4-2-11-27-26(20)30-23/h1,3,5,7,9,13,17-19,22H,2,4,6,8,10-12,14-16H2,(H,27,30)(H,33,34)/t19-,22-/m1/s1

Standard InChI Key:  ZHKXSTJFXIMBBI-DENIHFKCSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   34.4558  -17.1580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2408  -17.3849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7009  -16.7094    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.1979  -16.0621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4312  -16.3423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5978  -16.3465    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3074  -15.9371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3046  -15.1144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5960  -14.7091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8897  -15.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8939  -15.1180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1901  -14.7069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4777  -15.1109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4735  -15.9304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1818  -16.3460    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.0158  -16.3445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7229  -15.9348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5177  -16.6838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9483  -17.3784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7651  -17.3528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5620  -18.0986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1956  -18.0474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0124  -18.0218    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.8094  -18.7675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.7448  -18.1225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3586  -18.8418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7892  -19.5374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6102  -19.5090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9926  -18.7892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0472  -20.2020    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.7410  -20.9597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3670  -21.4850    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.0601  -21.0520    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.8623  -20.2591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
 10  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 11  1  0
 10 11  2  0
 10 15  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
  7 16  1  0
 16 17  1  0
  5 17  1  1
  3 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  1  1
 20 22  1  0
 22 23  1  0
 22 24  2  0
 21 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 21  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 30  1  0
 28 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4246111

    ---

Associated Targets(Human)

ITGAV Tchem Integrin alpha-V/beta-5 (589 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ITGB3 Tclin Integrin alpha-V/beta-3 (2708 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ITGB1 Tclin Integrin alpha-V/beta-1 (222 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ITGAV Tchem Integrin alpha-V/beta-6 (509 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ITGAV Tchem Integrin alpha-V/beta-8 (181 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KCNH2 Tclin HERG (29587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 460.58Molecular Weight (Monoisotopic): 460.2587AlogP: 3.53#Rotatable Bonds: 9
Polar Surface Area: 96.17Molecular Species: ZWITTERIONHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.88CX Basic pKa: 10.27CX LogP: -0.26CX LogD: -0.48
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.50Np Likeness Score: -0.71

References

1. Procopiou PA, Anderson NA, Barrett J, Barrett TN, Crawford MHJ, Fallon BJ, Hancock AP, Le J, Lemma S, Marshall RP, Morrell J, Pritchard JM, Rowedder JE, Saklatvala P, Slack RJ, Sollis SL, Suckling CJ, Thorp LR, Vitulli G, Macdonald SJF..  (2018)  Discovery of ( S)-3-(3-(3,5-Dimethyl-1 H-pyrazol-1-yl)phenyl)-4-(( R)-3-(2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl)pyrrolidin-1-yl)butanoic Acid, a Nonpeptidic αvβ6 Integrin Inhibitor for the Inhaled Treatment of Idiopathic Pulmonary Fibrosis.,  61  (18): [PMID:30215258] [10.1021/acs.jmedchem.8b00959]

Source