The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Amino-6-methoxyquinolinosophoridine ID: ALA4246502
PubChem CID: 145986004
Max Phase: Preclinical
Molecular Formula: C23H30N4O
Molecular Weight: 378.52
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2nc3c(c(N)c2c1)CC[C@@H]1[C@H]2CCCN4CCC[C@H](CN31)[C@@H]24
Standard InChI: InChI=1S/C23H30N4O/c1-28-15-6-8-19-18(12-15)21(24)17-7-9-20-16-5-3-11-26-10-2-4-14(22(16)26)13-27(20)23(17)25-19/h6,8,12,14,16,20,22H,2-5,7,9-11,13H2,1H3,(H2,24,25)/t14-,16-,20-,22+/m1/s1
Standard InChI Key: DZLOOJWCTFRPSJ-YKHKRFOZSA-N
Molfile:
RDKit 2D
32 37 0 0 0 0 0 0 0 0999 V2000
6.8058 -7.8170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8058 -8.6342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5111 -9.0386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2129 -8.6341 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9149 -9.0435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6250 -8.6401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6284 -7.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5111 -7.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2146 -7.8200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9224 -7.4208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5154 -6.5894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2294 -6.1886 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9353 -6.6077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6472 -6.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6596 -5.3881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2091 -6.9998 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.9148 -8.2379 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.6371 -7.0163 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.5033 -8.2214 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.2356 -5.3700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9525 -4.9699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9634 -4.1508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5331 -4.9537 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6766 -3.7517 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5405 -4.1360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2579 -3.7336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2670 -2.9130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5596 -2.4939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8415 -2.9012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8359 -3.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5674 -1.6767 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2789 -1.2748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 8 1 0
2 3 1 0
3 4 1 0
9 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 10 1 0
8 9 1 0
8 11 1 0
9 10 1 0
10 13 1 0
12 11 1 0
12 13 1 0
12 20 1 0
13 14 1 0
14 15 1 0
15 21 1 0
9 16 1 6
10 17 1 6
13 18 1 1
8 19 1 1
20 21 2 0
21 22 1 0
22 26 2 0
25 23 2 0
23 20 1 0
22 24 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
31 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 378.52Molecular Weight (Monoisotopic): 378.2420AlogP: 3.45#Rotatable Bonds: 1Polar Surface Area: 54.62Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.04CX LogP: 3.32CX LogD: -0.78Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.82Np Likeness Score: 0.38
References 1. Xu Y, Jing D, Chen R, Rashid HU, Jiang J, Liu X, Wang L, Xie P.. (2018) Design, synthesis and evaluation of novel sophoridinic imine derivatives containing conjugated planar structure as potent anticancer agents., 26 (14): [PMID:30007563 ] [10.1016/j.bmc.2018.07.001 ]