The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1E,5E)-7-(2,6-dihydroxy-3-((E)-3-(4-hydroxyphenyl)acryloyl)phenyl)-1-(4-hydroxy-3-methoxyphenyl)-5-methylhepta-1,5-dien-3-one ID: ALA4247203
PubChem CID: 145983589
Max Phase: Preclinical
Molecular Formula: C30H28O7
Molecular Weight: 500.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C/C(=O)C/C(C)=C/Cc2c(O)ccc(C(=O)/C=C/c3ccc(O)cc3)c2O)ccc1O
Standard InChI: InChI=1S/C30H28O7/c1-19(17-23(32)11-6-21-8-15-28(35)29(18-21)37-2)3-12-24-27(34)16-13-25(30(24)36)26(33)14-7-20-4-9-22(31)10-5-20/h3-11,13-16,18,31,34-36H,12,17H2,1-2H3/b11-6+,14-7+,19-3+
Standard InChI Key: HVRDWFTXWOAEEX-GGYLRJSXSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
7.0644 -18.2629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0633 -19.0825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7713 -19.4914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4810 -19.0820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4781 -18.2593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7695 -17.8541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3566 -17.8545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7711 -20.3086 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1893 -19.4895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1906 -20.3067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8964 -19.0798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8951 -18.2626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6022 -17.8529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3081 -18.2614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0147 -17.8524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0139 -17.0343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3005 -16.6270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5969 -17.0384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7204 -16.6237 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3552 -19.4905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3546 -20.3077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6465 -20.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6459 -21.5329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9392 -20.3066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9379 -21.9410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9372 -22.7582 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2305 -21.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5224 -21.9399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8151 -21.5307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8188 -20.7155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1122 -20.3064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4032 -20.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4052 -21.5359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1123 -21.9413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1132 -19.4892 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8215 -19.0816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6953 -20.3063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
3 8 1 0
4 9 1 0
9 10 2 0
9 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
2 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
22 24 1 0
23 25 1 0
25 26 2 0
25 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
31 35 1 0
35 36 1 0
32 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 500.55Molecular Weight (Monoisotopic): 500.1835AlogP: 5.58#Rotatable Bonds: 10Polar Surface Area: 124.29Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.93CX Basic pKa: ┄CX LogP: 6.71CX LogD: 6.09Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.16Np Likeness Score: 1.35
References 1. Li YR, Li GH, Zhou MX, Xiang L, Ren DM, Lou HX, Wang XN, Shen T.. (2018) Discovery of natural flavonoids as activators of Nrf2-mediated defense system: Structure-activity relationship and inhibition of intracellular oxidative insults., 26 (18): [PMID:30227999 ] [10.1016/j.bmc.2018.09.010 ]