The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(6R,7R)-7-((2R)-2-(4-hydroxy-5-isobutyl-2-oxo-2,5-dihydro-1H-pyrrole-3-carboxamido)-2-phenylacetamido)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid ID: ALA4247419
PubChem CID: 145986247
Max Phase: Preclinical
Molecular Formula: C25H28N4O7S
Molecular Weight: 528.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C(C(=O)O)N2C(=O)[C@@H](NC(=O)[C@H](NC(=O)C3=C(O)C(CC(C)C)NC3=O)c3ccccc3)[C@H]2SC1
Standard InChI: InChI=1S/C25H28N4O7S/c1-11(2)9-14-19(30)15(20(31)26-14)21(32)27-16(13-7-5-4-6-8-13)22(33)28-17-23(34)29-18(25(35)36)12(3)10-37-24(17)29/h4-8,11,14,16-17,24,30H,9-10H2,1-3H3,(H,26,31)(H,27,32)(H,28,33)(H,35,36)/t14?,16-,17-,24-/m1/s1
Standard InChI Key: PIRVNVGJXQUSDJ-RLOMDYAQSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
3.9469 -30.8891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7641 -30.8891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0185 -31.6658 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3555 -32.1479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6968 -31.6658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9318 -26.6428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7490 -26.6428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4876 -28.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0767 -28.7754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4852 -29.4837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3046 -29.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7136 -28.7703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3027 -28.0649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5308 -28.7674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9419 -29.4737 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9368 -28.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7540 -28.0553 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5257 -27.3520 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3269 -27.2207 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2192 -26.2285 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.9301 -25.8286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7490 -25.8257 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1537 -25.1190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7440 -24.4106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9251 -24.4135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5159 -25.1248 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.9709 -25.1173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3810 -25.8241 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3780 -24.4087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1511 -23.7020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5358 -30.1828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7186 -30.1857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9195 -31.9180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2437 -30.2274 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3543 -32.9651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0614 -33.3748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0601 -34.1920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7697 -32.9673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 2 0
21 6 1 0
6 7 1 0
7 22 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
14 12 1 6
14 15 1 0
14 16 1 0
16 17 2 0
16 18 1 0
6 18 1 1
7 19 2 0
21 20 1 6
21 22 1 0
21 26 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 1 0
23 27 1 0
27 28 2 0
27 29 1 0
24 30 1 0
15 31 1 0
31 1 1 0
31 32 2 0
5 33 1 0
2 34 2 0
4 35 1 0
35 36 1 0
36 37 1 0
36 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 528.59Molecular Weight (Monoisotopic): 528.1679AlogP: 0.96#Rotatable Bonds: 8Polar Surface Area: 165.14Molecular Species: ACIDHBA: 7HBD: 5#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.50CX Basic pKa: ┄CX LogP: 0.32CX LogD: -5.28Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.25Np Likeness Score: 0.24
References 1. Cherian PT, Cheramie MN, Marreddy RKR, Fernando DM, Hurdle JG, Lee RE.. (2018) New β-lactam - Tetramic acid hybrids show promising antibacterial activities., 28 (18): [PMID:30097368 ] [10.1016/j.bmcl.2018.07.018 ]