(S)-3-(4-hydroxyphenethylamino)-2-(3-methylbut-2-enamido)-3-oxopropyl dihydrogen phosphate

ID: ALA4247540

PubChem CID: 145983593

Max Phase: Preclinical

Molecular Formula: C16H23N2O7P

Molecular Weight: 386.34

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)=CC(=O)N[C@@H](COP(=O)(O)O)C(=O)NCCc1ccc(O)cc1

Standard InChI:  InChI=1S/C16H23N2O7P/c1-11(2)9-15(20)18-14(10-25-26(22,23)24)16(21)17-8-7-12-3-5-13(19)6-4-12/h3-6,9,14,19H,7-8,10H2,1-2H3,(H,17,21)(H,18,20)(H2,22,23,24)/t14-/m0/s1

Standard InChI Key:  LVOFJZQGGXXLIM-AWEZNQCLSA-N

Molfile:  

     RDKit          2D

 26 26  0  0  0  0  0  0  0  0999 V2000
   29.3405  -16.9505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0482  -16.5419    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.6328  -16.5419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3405  -17.7677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.9251  -16.9505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7559  -16.9505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4636  -16.5419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7559  -17.7677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1713  -16.9505    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.4636  -15.7247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.4636  -18.1763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.4636  -18.9935    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   32.1713  -19.4021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.7559  -19.4021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.1676  -18.5767    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.8790  -16.5419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5867  -16.9505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2944  -16.5419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0010  -16.9546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7083  -16.5466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7087  -15.7286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9960  -15.3201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2917  -15.7304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4159  -15.3190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.2173  -16.5419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9251  -17.7677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  3  5  2  0
  2  6  1  0
  6  7  1  0
  6  8  1  6
  7  9  1  0
  7 10  2  0
  8 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 12 15  1  0
  9 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
  5 25  1  0
  5 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4247540

    ---

Associated Targets(Human)

SFN Tbio 14-3-3 protein sigma (29 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 386.34Molecular Weight (Monoisotopic): 386.1243AlogP: 0.61#Rotatable Bonds: 9
Polar Surface Area: 145.19Molecular Species: ACIDHBA: 5HBD: 5
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 1.37CX Basic pKa: CX LogP: 0.58CX LogD: -2.83
Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.31Np Likeness Score: 0.44

References

1. Stevers LM, Sijbesma E, Botta M, MacKintosh C, Obsil T, Landrieu I, Cau Y, Wilson AJ, Karawajczyk A, Eickhoff J, Davis J, Hann M, O'Mahony G, Doveston RG, Brunsveld L, Ottmann C..  (2018)  Modulators of 14-3-3 Protein-Protein Interactions.,  61  (9): [PMID:28968506] [10.1021/acs.jmedchem.7b00574]

Source