3-((3S,3aR,4R,5aR,6S,9aR,9bR)-4-hydroxy-6,9a,9b-trimethyl-8-oxo-3-((R)-2,6,6-trimethyltetrahydro-2H-pyran-2-yl)dodecahydro-1H-cyclopenta[a]naphthalen-6-yl)propanoic acid

ID: ALA4248673

PubChem CID: 145983854

Max Phase: Preclinical

Molecular Formula: C27H44O5

Molecular Weight: 448.64

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(C)CCC[C@](C)([C@H]2CC[C@]3(C)[C@@H]2[C@H](O)C[C@@H]2[C@@](C)(CCC(=O)O)CC(=O)C[C@]23C)O1

Standard InChI:  InChI=1S/C27H44O5/c1-23(2)10-7-11-27(6,32-23)18-8-13-25(4)22(18)19(29)14-20-24(3,12-9-21(30)31)15-17(28)16-26(20,25)5/h18-20,22,29H,7-16H2,1-6H3,(H,30,31)/t18-,19+,20+,22-,24-,25+,26+,27+/m0/s1

Standard InChI Key:  BPOCXSHOKZMVTQ-WKFGEGFWSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   26.9260  -10.7060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6400  -11.1188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6390  -10.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4445  -15.9772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1587  -15.5698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4514  -14.3346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1583  -14.7509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1750  -13.1121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4567  -13.5160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8777  -13.5325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8689  -14.3504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6442  -14.6104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1339  -13.9530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6585  -13.2896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9227  -12.5144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7293  -12.3508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9910  -11.5763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4496  -10.9600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3778  -11.8994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.7345  -13.9211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4444  -15.1552    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   25.4399  -16.7985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1501  -13.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1850  -12.2908    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.8641  -15.1717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8724  -12.7077    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   28.4779  -13.2855    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   28.6306  -12.9224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7435  -14.7425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7383  -15.5638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0329  -14.3339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3259  -14.7437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6174  -14.3364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9104  -14.7462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.6160  -13.5192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
 29  6  1  0
 30  4  1  0
  4  5  1  0
  5  7  1  0
  6  7  1  0
  6  9  1  0
  7 11  1  0
 10  8  1  0
  8  9  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 10  1  0
 15 16  1  0
 15 19  1  0
 16 17  1  0
 17 18  1  0
 18  2  1  0
  2 19  1  0
 14 15  1  0
 29 20  1  1
  6 21  1  6
  4 22  2  0
  7 23  1  1
  8 24  1  1
 11 25  1  6
 10 26  1  1
 14 27  1  6
 15 28  1  1
 29 30  1  0
 29 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4248673

    ---

Associated Targets(Human)

ATP1A1 Tclin Sodium/potassium-transporting ATPase (386 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.64Molecular Weight (Monoisotopic): 448.3189AlogP: 5.38#Rotatable Bonds: 4
Polar Surface Area: 83.83Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.58CX Basic pKa: CX LogP: 3.95CX LogD: 1.21
Aromatic Rings: Heavy Atoms: 32QED Weighted: 0.60Np Likeness Score: 2.66

References

1. Wu Q, Chen P, Tu G, Li M, Pan B, Guo Y, Zhai J, Fu H..  (2018)  Synthesis and evaluation of panaxatriol derivatives as Na+, K+-ATPase inhibitors.,  28  (17): [PMID:30049579] [10.1016/j.bmcl.2018.07.027]

Source