((R)-1-((S)-2-heptanamido-3-phenylpropanamido)-3-methylbutyl)boronic acid

ID: ALA4249022

PubChem CID: 145985104

Max Phase: Preclinical

Molecular Formula: C21H35BN2O4

Molecular Weight: 390.33

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)B(O)O

Standard InChI:  InChI=1S/C21H35BN2O4/c1-4-5-6-10-13-20(25)23-18(15-17-11-8-7-9-12-17)21(26)24-19(22(27)28)14-16(2)3/h7-9,11-12,16,18-19,27-28H,4-6,10,13-15H2,1-3H3,(H,23,25)(H,24,26)/t18-,19-/m0/s1

Standard InChI Key:  YGEROGXGLAYWKH-OALUTQOASA-N

Molfile:  

     RDKit          2D

 28 28  0  0  0  0  0  0  0  0999 V2000
   41.3230  -20.5019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0364  -20.9078    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.3199  -19.6806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.7426  -20.4966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.4559  -20.9025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1662  -20.4912    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.4590  -21.7238    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.8796  -20.8972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.5899  -20.4859    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
   44.8827  -21.7185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.5960  -22.1285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.5991  -22.9498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.3063  -21.7131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.3032  -20.8918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.5868  -19.6646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.6127  -20.9132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8994  -20.5072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7395  -19.6753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.4498  -19.2599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1596  -19.6738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.8694  -19.2591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.8667  -18.4370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1484  -18.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.4415  -18.4441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8963  -19.6859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1829  -19.2759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1798  -18.4546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4665  -18.0486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  2  0
  6  8  1  0
  8  9  1  0
  8 10  1  6
 10 11  1  0
 11 12  1  0
 11 13  1  0
  9 14  1  0
  9 15  1  0
  1 16  1  0
 16 17  1  0
  4 18  1  1
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 17 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4249022

    ---

Associated Targets(Human)

ARH-77 (115 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
U-266 (527 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
RPMI-8226 (44974 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PSMB5 Tclin Proteasome Macropain subunit MB1 (2451 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 390.33Molecular Weight (Monoisotopic): 390.2690AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Lei M, Feng H, Bai E, Zhou H, Wang J, Shi J, Wang X, Hu S, Liu Z, Zhu Y..  (2018)  Design, synthesis, in vitro and in vivo evaluation, and structure-activity relationship (SAR) discussion of novel dipeptidyl boronic acid proteasome inhibitors as orally available anti-cancer agents for the treatment of multiple myeloma and mechanism studies.,  26  (14): [PMID:29934218] [10.1016/j.bmc.2018.06.020]

Source