The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4249044
PubChem CID: 145985579
Max Phase: Preclinical
Molecular Formula: C37H50F3NO4
Molecular Weight: 629.80
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)CCC[C@](C)([C@H]2CC[C@]3(C)[C@@H]2[C@H](O)C[C@@H]2[C@@]4(C)Cc5c([nH]c6ccc(OC(F)(F)F)cc56)C(C)(C)[C@@H]4C(=O)C[C@]23C)O1
Standard InChI: InChI=1S/C37H50F3NO4/c1-31(2)13-9-14-36(8,45-31)23-12-15-34(6)28(23)25(42)17-27-33(5)18-22-21-16-20(44-37(38,39)40)10-11-24(21)41-30(22)32(3,4)29(33)26(43)19-35(27,34)7/h10-11,16,23,25,27-29,41-42H,9,12-15,17-19H2,1-8H3/t23-,25+,27+,28-,29-,33+,34+,35+,36+/m0/s1
Standard InChI Key: BJTJHPNQMGQVLK-ZUVMCECZSA-N
Molfile:
RDKit 2D
49 55 0 0 0 0 0 0 0 0999 V2000
23.9668 -26.2244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9709 -25.4031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2570 -25.8081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8683 -20.1367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5823 -20.5495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5812 -19.7263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9746 -23.7605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6840 -24.1732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6805 -24.9945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3867 -25.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1009 -25.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3937 -23.7653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1005 -24.1817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1172 -22.5428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3989 -22.9467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8199 -22.9633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8111 -23.7811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5864 -24.0411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0761 -23.3838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6007 -22.7203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8649 -21.9451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6715 -21.7815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9332 -21.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3918 -20.3908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3200 -21.3301 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6726 -25.8117 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
24.6767 -23.3519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3866 -24.5859 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
25.3821 -26.2292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.0923 -23.3601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1273 -21.7215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.8063 -24.6024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8146 -22.1385 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
28.4201 -22.7163 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
28.5728 -22.3531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2652 -24.9945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2607 -24.1732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4855 -25.2525 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.9991 -24.5908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4789 -23.9293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1458 -23.1851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3331 -23.1012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8547 -23.7676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1904 -24.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9980 -22.3559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4758 -21.6930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1406 -20.9477 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.2888 -21.7754 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.8784 -20.9828 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
37 7 1 0
36 2 1 0
2 9 1 0
8 7 1 0
8 9 1 0
8 12 1 0
9 10 1 0
10 11 1 0
11 13 1 0
12 13 1 0
12 15 1 0
13 17 1 0
16 14 1 0
14 15 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 16 1 0
21 22 1 0
21 25 1 0
22 23 1 0
23 24 1 0
24 5 1 0
5 25 1 0
20 21 1 0
9 26 1 6
8 27 1 1
12 28 1 6
10 29 2 0
13 30 1 1
14 31 1 1
17 32 1 6
16 33 1 1
20 34 1 6
21 35 1 1
36 37 2 0
37 40 1 0
39 38 1 0
38 36 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 43 1 0
43 44 2 0
44 39 1 0
42 45 1 0
45 46 1 0
46 47 1 0
46 48 1 0
46 49 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 629.80Molecular Weight (Monoisotopic): 629.3692AlogP: 8.65#Rotatable Bonds: 2Polar Surface Area: 71.55Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 8.14CX LogD: 8.14Aromatic Rings: 2Heavy Atoms: 45QED Weighted: 0.35Np Likeness Score: 1.83
References 1. Wu Q, Chen P, Tu G, Li M, Pan B, Guo Y, Zhai J, Fu H.. (2018) Synthesis and evaluation of panaxatriol derivatives as Na+, K+-ATPase inhibitors., 28 (17): [PMID:30049579 ] [10.1016/j.bmcl.2018.07.027 ] 2. Wu Q, Wang R, Shi Y, Li W, Li M, Chen P, Pan B, Wang Q, Li C, Wang J, Sun G, Sun X, Fu H.. (2020) Synthesis and biological evaluation of panaxatriol derivatives against myocardial ischemia/reperfusion injury in the rat., 185 [PMID:31655431 ] [10.1016/j.ejmech.2019.111729 ]