The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-(2-(4-azidobenzamido)acetamido)-3-(4-hydroxyphenethylamino)-3-oxopropyl dihydrogen phosphate ID: ALA4250552
PubChem CID: 49793813
Max Phase: Preclinical
Molecular Formula: C20H23N6O8P
Molecular Weight: 506.41
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: [N-]=[N+]=Nc1ccc(C(=O)NCC(=O)N[C@@H](COP(=O)(O)O)C(=O)NCCc2ccc(O)cc2)cc1
Standard InChI: InChI=1S/C20H23N6O8P/c21-26-25-15-5-3-14(4-6-15)19(29)23-11-18(28)24-17(12-34-35(31,32)33)20(30)22-10-9-13-1-7-16(27)8-2-13/h1-8,17,27H,9-12H2,(H,22,30)(H,23,29)(H,24,28)(H2,31,32,33)/t17-/m0/s1
Standard InChI Key: KPRPEUSNRKOIDZ-KRWDZBQOSA-N
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
7.6436 -9.6371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3513 -9.2285 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9359 -9.2285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6436 -10.4543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2282 -9.6371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5205 -9.2285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8128 -9.6371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5205 -8.4113 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1058 -9.2252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3985 -9.6331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3981 -10.4512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1108 -10.8596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8151 -10.4493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0590 -9.6371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7668 -9.2285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0590 -10.4543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4745 -9.6371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7668 -8.4113 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7668 -10.8629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7668 -11.6801 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
10.4745 -12.0887 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0590 -12.0887 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4708 -11.2632 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1822 -9.2285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8899 -9.6371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5976 -9.2285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3042 -9.6411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0114 -9.2332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0119 -8.4151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2992 -8.0067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5949 -8.4170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7190 -8.0056 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6909 -10.8607 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9827 -10.4530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2712 -10.0415 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
3 5 1 0
5 6 1 0
6 7 1 0
6 8 2 0
7 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 7 1 0
2 14 1 0
14 15 1 0
14 16 1 6
15 17 1 0
15 18 2 0
16 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
20 23 1 0
17 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
29 32 1 0
11 33 1 0
33 34 2 0
34 35 2 0
M CHG 2 34 1 35 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 506.41Molecular Weight (Monoisotopic): 506.1315AlogP: 1.02#Rotatable Bonds: 12Polar Surface Area: 223.05Molecular Species: ACIDHBA: 7HBD: 6#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: -10.67CX Basic pKa: ┄CX LogP: 0.37CX LogD: -3.16Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.11Np Likeness Score: -0.27
References 1. Stevers LM, Sijbesma E, Botta M, MacKintosh C, Obsil T, Landrieu I, Cau Y, Wilson AJ, Karawajczyk A, Eickhoff J, Davis J, Hann M, O'Mahony G, Doveston RG, Brunsveld L, Ottmann C.. (2018) Modulators of 14-3-3 Protein-Protein Interactions., 61 (9): [PMID:28968506 ] [10.1021/acs.jmedchem.7b00574 ]