5-hydroxy-4-((1R,2S)-1-hydroxy-2-((3S,5S,6R,7R,8R,9S,10R,13S,14R)-3,6,7-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,10,11,12,13,14,15-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)propyl)furan-2(5H)-one

ID: ALA4251058

PubChem CID: 145985367

Max Phase: Preclinical

Molecular Formula: C26H38O7

Molecular Weight: 462.58

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H](C1=CC[C@@H]2[C@@H]3[C@@H](O)[C@H](O)[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)[C@@H](O)C1=CC(=O)OC1O

Standard InChI:  InChI=1S/C26H38O7/c1-12(21(29)14-11-19(28)33-24(14)32)15-4-5-16-20-17(7-9-25(15,16)2)26(3)8-6-13(27)10-18(26)22(30)23(20)31/h4,11-13,16-18,20-24,27,29-32H,5-10H2,1-3H3/t12-,13-,16+,17-,18+,20-,21+,22+,23+,24?,25+,26+/m0/s1

Standard InChI Key:  VWHHSLQAGKDWBW-PKPBRPFHSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   16.8962  -20.9274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8962  -21.7528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6085  -22.1613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3209  -21.7528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6085  -20.5105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3192  -20.9304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0341  -20.5272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0447  -19.7025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8878  -20.0978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6085  -22.9867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7643  -19.2980    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7442  -20.9481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6129  -19.6874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3344  -19.2873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9215  -18.4407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9056  -19.2671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6430  -18.0406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3489  -18.4629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9686  -17.9221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6458  -17.1656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8266  -17.2388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9253  -17.6256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2839  -16.6169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5512  -15.8359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4740  -16.7759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3612  -15.6769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0086  -15.2140    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9661  -16.2355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6873  -15.8340    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.5283  -15.0240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7088  -14.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0900  -14.4193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1765  -17.0295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9025  -21.5138    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.1963  -20.2708    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.6199  -18.8748    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.0633  -18.8754    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  5  1  0
  2  3  1  0
  3  4  1  0
  4  6  1  0
  5  6  1  0
  5 13  1  0
  6  7  1  0
  7  8  1  0
  8 14  1  0
  5  9  1  1
  3 10  1  1
  8 11  1  1
  7 12  1  6
 13 14  1  0
 13 16  1  0
 14 18  1  0
 17 15  1  0
 15 16  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 17  1  0
 17 22  1  1
 21 23  1  0
 23 24  1  0
 23 25  1  6
 24 26  1  0
 24 27  1  1
 26 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 26  2  0
 30 32  2  0
 28 33  1  0
  6 34  1  6
 13 35  1  6
 14 36  1  1
 18 37  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4251058

    ---

Associated Targets(Human)

PLA2G2A Tchem Phospholipase A2 group IIA (1079 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 462.58Molecular Weight (Monoisotopic): 462.2618AlogP: 1.67#Rotatable Bonds: 3
Polar Surface Area: 127.45Molecular Species: ACIDHBA: 7HBD: 5
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 5.50CX Basic pKa: CX LogP: 1.10CX LogD: -0.80
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.32Np Likeness Score: 2.83

References

1. Choudhary S, Singh PK, Verma H, Singh H, Silakari O..  (2018)  Success stories of natural product-based hybrid molecules for multi-factorial diseases.,  151  [PMID:29605809] [10.1016/j.ejmech.2018.03.057]

Source