[2-(4-Bromo-phenyl)-ethyl]-(1H-imidazol-4-ylmethyl)-(4-phenoxy-benzyl)-amine

ID: ALA425159

PubChem CID: 44390085

Max Phase: Preclinical

Molecular Formula: C25H24BrN3O

Molecular Weight: 462.39

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Brc1ccc(CCN(Cc2ccc(Oc3ccccc3)cc2)Cc2c[nH]cn2)cc1

Standard InChI:  InChI=1S/C25H24BrN3O/c26-22-10-6-20(7-11-22)14-15-29(18-23-16-27-19-28-23)17-21-8-12-25(13-9-21)30-24-4-2-1-3-5-24/h1-13,16,19H,14-15,17-18H2,(H,27,28)

Standard InChI Key:  CMGIYMUBWMWULU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   -3.5875   -1.3667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8208   -1.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7000   -0.0250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1458   -0.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9000   -0.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4000   -1.0375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1125   -1.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1625    0.2083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6875   -1.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4500   -0.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0375   -1.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4000   -0.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6958    2.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6875    1.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8792   -0.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6958    3.5000    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   -0.6875    0.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7375    0.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4542   -1.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0250    2.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4000    2.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7375   -1.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0250   -0.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4000    1.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0250    1.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8875   -1.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5875    0.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6000   -1.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3042   -0.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3125   -1.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  4  1  0
  4  1  2  0
  5  2  2  0
  6  7  1  0
  7  2  1  0
  8 10  1  0
  9  6  1  0
 10 18  1  0
 11  9  1  0
 12  6  1  0
 13 20  2  0
 14 17  1  0
 15  8  1  0
 16 13  1  0
 17 12  1  0
 18 23  2  0
 19 22  1  0
 20 25  1  0
 21 24  2  0
 22 11  2  0
 23 11  1  0
 24 14  1  0
 25 14  2  0
 26 15  2  0
 27 15  1  0
 28 26  1  0
 29 27  2  0
 30 29  1  0
  3  5  1  0
 10 19  2  0
 13 21  1  0
 30 28  2  0
M  END

Associated Targets(Human)

FNTA Tclin Geranylgeranyl transferase type I (851 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FNTA Tclin Protein farnesyltransferase (3470 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 462.39Molecular Weight (Monoisotopic): 461.1103AlogP: 6.21#Rotatable Bonds: 9
Polar Surface Area: 41.15Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.91CX Basic pKa: 7.37CX LogP: 5.88CX LogD: 5.60
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.32Np Likeness Score: -0.92

References

1. Saha AK, End DW..  (2005)  Novel beta-(imidazol-4-yl)-beta-amino acids: solid-phase synthesis and study of their inhibitory activity against geranylgeranyl protein transferase type I.,  15  (6): [PMID:15745827] [10.1016/j.bmcl.2005.01.042]

Source