7-(2-fluorophenyl)-3-(4-fluorophenyl)-2-((2-methyl-2H-1,2,4-triazol-3-yl)methoxy)pyrazolo[1,5-d][1,2,4]triazine

ID: ALA426860

PubChem CID: 9931873

Max Phase: Preclinical

Molecular Formula: C21H15F2N7O

Molecular Weight: 419.40

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cn1ncnc1COc1nn2c(-c3ccccc3F)nncc2c1-c1ccc(F)cc1

Standard InChI:  InChI=1S/C21H15F2N7O/c1-29-18(24-12-26-29)11-31-21-19(13-6-8-14(22)9-7-13)17-10-25-27-20(30(17)28-21)15-4-2-3-5-16(15)23/h2-10,12H,11H2,1H3

Standard InChI Key:  JHXTWTGOXRMYJM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   16.1277  -22.0769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3112  -22.2209    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.1940  -23.0376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9346  -23.4014    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5093  -22.8094    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.3256  -22.9288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8342  -17.8030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2654  -18.6301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2623  -17.7990    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.5440  -17.3901    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.5460  -19.0435    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8316  -18.6275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2150  -19.1783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5484  -19.9349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3710  -19.8515    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1332  -20.6479    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4991  -18.7687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5018  -17.9465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7869  -17.5363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0727  -17.9511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0780  -18.7805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7936  -19.1870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9803  -19.0420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9790  -19.8668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6930  -20.2787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4081  -19.8654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4047  -19.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6901  -18.6280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6863  -17.8030    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.5429  -21.3639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3562  -17.5419    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
 15 11  1  0
  2  3  1  0
 14 16  1  0
 11  8  1  0
 13 17  1  0
  3  4  2  0
 17 18  2  0
  8  9  2  0
 18 19  1  0
  4  5  1  0
 19 20  2  0
  9 10  1  0
 20 21  1  0
 10  7  2  0
 21 22  2  0
 22 17  1  0
 11 12  1  0
  8 23  1  0
  5  1  1  0
 23 24  2  0
 24 25  1  0
  5  6  1  0
 25 26  2  0
  1  2  2  0
 26 27  1  0
  7 12  1  0
 27 28  2  0
 28 23  1  0
 12 13  2  0
 28 29  1  0
 13 14  1  0
 16 30  1  0
 30  1  1  0
 14 15  2  0
 20 31  1  0
M  END

Associated Targets(Human)

GABRG2 Tclin GABA-A receptor; alpha-3/beta-3/gamma-2 (1250 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GABRA1 Tclin GABA-A receptor; alpha-1/beta-3/gamma-2 (1565 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.40Molecular Weight (Monoisotopic): 419.1306AlogP: 3.44#Rotatable Bonds: 5
Polar Surface Area: 83.02Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.08CX LogP: 3.26CX LogD: 3.26
Aromatic Rings: 5Heavy Atoms: 31QED Weighted: 0.43Np Likeness Score: -1.71

References

1. Carling RW, Russell MG, Moore KW, Mitchinson A, Guiblin A, Smith A, Wafford KA, Marshall G, Atack JR, Street LJ..  (2006)  2,3,7-Trisubstituted pyrazolo[1,5-d][1,2,4]triazines: functionally selective GABAA alpha3-subtype agonists.,  16  (13): [PMID:16621541] [10.1016/j.bmcl.2006.03.081]

Source