The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,4-bis(1-(2,4-difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethoxy)butane ID: ALA4276799
PubChem CID: 145985641
Max Phase: Preclinical
Molecular Formula: C24H24F4N6O2
Molecular Weight: 504.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Fc1ccc(C(Cn2cncn2)OCCCCOC(Cn2cncn2)c2ccc(F)cc2F)c(F)c1
Standard InChI: InChI=1S/C24H24F4N6O2/c25-17-3-5-19(21(27)9-17)23(11-33-15-29-13-31-33)35-7-1-2-8-36-24(12-34-16-30-14-32-34)20-6-4-18(26)10-22(20)28/h3-6,9-10,13-16,23-24H,1-2,7-8,11-12H2
Standard InChI Key: WPZMZWZBRCCINR-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
30.1011 -4.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4106 -4.5907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4486 -5.4075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1764 -5.7838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8674 -5.3373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8259 -4.5220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7607 -5.8486 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.5948 -5.7096 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.5124 -4.0788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2396 -4.4517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4718 -3.2626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.9261 -4.0084 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.6868 -4.3007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2027 -3.6670 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7595 -2.9804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9696 -3.1899 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.5202 -4.4986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5190 -5.3182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2271 -5.7271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9367 -5.3177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9339 -4.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2253 -4.0898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2269 -6.5443 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.6401 -4.0838 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.2228 -3.2726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9293 -2.8619 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.6382 -3.2684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5139 -2.8661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8099 -4.0940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8077 -3.2812 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.0340 -3.0321 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5579 -3.6909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0375 -4.3472 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.3447 -2.8577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0536 -3.2641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7601 -2.8534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
5 8 1 0
6 9 1 0
9 10 1 0
9 11 1 0
10 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 12 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
19 23 1 0
21 24 1 0
22 25 1 0
25 26 1 0
26 27 1 0
25 28 1 0
28 30 1 0
29 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 29 2 0
27 34 1 0
34 35 1 0
35 36 1 0
36 11 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 504.49Molecular Weight (Monoisotopic): 504.1897AlogP: 4.42#Rotatable Bonds: 13Polar Surface Area: 79.88Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 2.31CX LogP: 3.88CX LogD: 3.88Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.20Np Likeness Score: -0.85
References 1. Zhang Y, Damu GLV, Cui SF, Mi JL, Tangadanchu VKR, Zhou CH.. (2017) Discovery of potential antifungal triazoles: design, synthesis, biological evaluation, and preliminary antifungal mechanism exploration., 8 (8): [PMID:30108874 ] [10.1039/C7MD00112F ]