The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(3-(4-(6-fluorobenzo[d]isoxazol-3-yl)piperidin-1-yl)propoxy)-3-(hydroxymethyl)chroman-4-one ID: ALA4276808
PubChem CID: 145986084
Max Phase: Preclinical
Molecular Formula: C25H27FN2O5
Molecular Weight: 454.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C1c2ccc(OCCCN3CCC(c4noc5cc(F)ccc45)CC3)cc2OCC1CO
Standard InChI: InChI=1S/C25H27FN2O5/c26-18-2-4-20-23(12-18)33-27-24(20)16-6-9-28(10-7-16)8-1-11-31-19-3-5-21-22(13-19)32-15-17(14-29)25(21)30/h2-5,12-13,16-17,29H,1,6-11,14-15H2
Standard InChI Key: POJKECCBFJBJQK-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
5.4441 -12.1797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4441 -13.0060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1537 -13.4172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8675 -13.0060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8675 -12.1797 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1537 -11.7643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7267 -13.4227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8337 -14.4170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6419 -14.2447 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4175 -13.7013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9721 -13.0892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7164 -12.3066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9107 -12.1347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3610 -12.7517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6155 -13.5320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5523 -12.5825 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.5849 -11.7706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2999 -12.1838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0173 -11.7748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7323 -12.1880 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4497 -11.7789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1574 -12.1956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1572 -10.5428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4474 -10.9576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8772 -10.9599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8722 -11.7850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5807 -12.1974 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2989 -11.7936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3040 -10.9687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5908 -10.5474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5947 -9.7210 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0231 -10.5585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7363 -10.9788 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
7 11 1 0
10 8 1 0
8 9 1 0
9 7 2 0
2 7 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
14 16 1 0
5 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 26 1 0
25 23 1 0
23 24 2 0
24 21 1 0
25 26 2 0
25 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
29 32 1 0
32 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.50Molecular Weight (Monoisotopic): 454.1904AlogP: 3.80#Rotatable Bonds: 7Polar Surface Area: 85.03Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.97CX LogP: 2.42CX LogD: 1.75Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.54Np Likeness Score: -0.55
References 1. Rakesh KP, Shantharam CS, Sridhara MB, Manukumar HM, Qin HL.. (2017) Benzisoxazole: a privileged scaffold for medicinal chemistry., 8 (11): [PMID:30108720 ] [10.1039/C7MD00449D ]