The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2alpha,3beta,23-Tris(acetyloxy)-N-(phenylmethyl)-urs-12-en-28-amide ID: ALA4277168
PubChem CID: 71467321
Max Phase: Preclinical
Molecular Formula: C43H61NO7
Molecular Weight: 703.96
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)OC[C@@]1(C)[C@@H]2CC[C@]3(C)[C@H](CC=C4[C@@H]5[C@@H](C)[C@H](C)CC[C@]5(C(=O)NCc5ccccc5)CC[C@]43C)[C@@]2(C)C[C@@H](OC(C)=O)[C@@H]1OC(C)=O
Standard InChI: InChI=1S/C43H61NO7/c1-26-17-20-43(38(48)44-24-31-13-11-10-12-14-31)22-21-41(8)32(36(43)27(26)2)15-16-35-39(6)23-33(50-29(4)46)37(51-30(5)47)40(7,25-49-28(3)45)34(39)18-19-42(35,41)9/h10-15,26-27,33-37H,16-25H2,1-9H3,(H,44,48)/t26-,27+,33-,34-,35-,36+,37+,39+,40+,41-,42-,43+/m1/s1
Standard InChI Key: GJUIQDAWVOGWRT-JSLFXHDISA-N
Molfile:
RDKit 2D
54 59 0 0 0 0 0 0 0 0999 V2000
19.2989 -13.1287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1569 -14.3421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2824 -13.9583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5684 -14.3545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0129 -12.7325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7187 -13.1617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4594 -15.5638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8626 -13.9335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1569 -15.1593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5890 -12.7160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4594 -13.9294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7536 -15.1593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4162 -13.5703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0253 -11.9029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7536 -14.3421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9799 -14.3751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5684 -15.1676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8750 -13.1163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6981 -13.9789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8626 -15.5679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4410 -12.7655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4162 -14.3793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7476 -11.5150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4533 -11.9401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8680 -16.2737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1569 -13.5249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0479 -15.5679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.2742 -14.7714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1302 -13.1617 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5643 -13.5373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0396 -13.9335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4511 -16.9794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.3237 -11.4819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7682 -10.7019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1528 -15.9724 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
17.8626 -14.7507 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
20.0047 -13.5497 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.0365 -13.1163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3272 -12.7105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7426 -12.7050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3397 -15.1602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6325 -15.5696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3387 -14.3430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8527 -17.6911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4371 -18.3948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6698 -17.6992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8363 -13.5730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5456 -13.1672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2503 -13.5805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9591 -13.1753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9626 -12.3573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2515 -11.9461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5456 -12.3537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8774 -16.1416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 8 1 0
3 1 1 0
4 3 1 0
5 1 1 0
6 5 1 0
7 9 1 0
8 18 1 0
9 2 1 0
10 1 2 0
11 2 1 0
12 15 1 0
6 13 1 1
14 5 1 0
15 11 1 0
16 3 1 0
17 4 1 0
18 10 1 0
19 6 1 0
20 17 1 0
21 6 1 0
22 13 2 0
23 14 1 0
24 23 1 0
25 7 1 0
2 26 1 1
12 27 1 1
3 28 1 6
29 13 1 0
4 30 1 1
15 31 1 6
32 25 1 0
14 33 1 1
23 34 1 6
9 35 1 6
8 36 1 6
5 37 1 1
4 8 1 0
16 19 1 0
21 24 1 0
9 20 1 0
7 12 1 0
31 38 1 0
38 39 1 0
38 40 2 0
27 41 1 0
41 42 1 0
41 43 2 0
32 44 1 0
44 45 1 0
44 46 2 0
29 47 1 0
47 48 1 0
48 49 2 0
49 50 1 0
50 51 2 0
51 52 1 0
52 53 2 0
53 48 1 0
7 54 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 703.96Molecular Weight (Monoisotopic): 703.4448AlogP: 7.98#Rotatable Bonds: 7Polar Surface Area: 108.00Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 0.67CX LogP: 6.69CX LogD: 6.69Aromatic Rings: 1Heavy Atoms: 51QED Weighted: 0.17Np Likeness Score: 2.03
References 1. Kahnt M, Wiemann J, Fischer L, Sommerwerk S, Csuk R.. (2018) Transformation of asiatic acid into a mitocanic, bimodal-acting rhodamine B conjugate of nanomolar cytotoxicity., 159 [PMID:30278332 ] [10.1016/j.ejmech.2018.09.066 ]