Standard InChI: InChI=1S/C25H18ClNO5/c26-22-4-2-1-3-16(22)7-12-23(28)17-5-9-20(10-6-17)31-15-24(29)27-19-8-11-21-18(13-19)14-32-25(21)30/h1-13H,14-15H2,(H,27,29)/b12-7+
1.Shah CP, Kharkar PS.. (2018) Discovery of novel human inosine 5'-monophosphate dehydrogenase 2 (hIMPDH2) inhibitors as potential anticancer agents., 158 [PMID:30223117][10.1016/j.ejmech.2018.09.016]
2.Silbermann K, Shah CP, Sahu NU, Juvale K, Stefan SM, Kharkar PS, Wiese M.. (2019) Novel chalcone and flavone derivatives as selective and dual inhibitors of the transport proteins ABCB1 and ABCG2., 164 [PMID:30594677][10.1016/j.ejmech.2018.12.019]