tert-butyl 3-(2-(8-(2-aminophenylamino)-8-oxooctanamido)thiazol-4-yl)phenylcarbamate

ID: ALA4277593

PubChem CID: 145984617

Max Phase: Preclinical

Molecular Formula: C28H35N5O4S

Molecular Weight: 537.69

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(C)OC(=O)Nc1cccc(-c2csc(NC(=O)CCCCCCC(=O)Nc3ccccc3N)n2)c1

Standard InChI:  InChI=1S/C28H35N5O4S/c1-28(2,3)37-27(36)30-20-12-10-11-19(17-20)23-18-38-26(32-23)33-25(35)16-7-5-4-6-15-24(34)31-22-14-9-8-13-21(22)29/h8-14,17-18H,4-7,15-16,29H2,1-3H3,(H,30,36)(H,31,34)(H,32,33,35)

Standard InChI Key:  SSGXGSMTAIQPMA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 40  0  0  0  0  0  0  0  0999 V2000
    6.0383  -21.8622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0424  -22.6835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7480  -21.4500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7438  -20.6287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4552  -20.2145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4514  -19.3940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7369  -18.9882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0249  -19.4048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0322  -20.2240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1683  -20.6250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3285  -21.4572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6187  -21.8694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9048  -21.4644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1951  -21.8766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4812  -21.4716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4770  -20.6503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7631  -20.2412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7589  -19.4199    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0534  -20.6575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4687  -19.0077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2212  -19.3342    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.7690  -18.7200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3527  -18.0143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5501  -18.1884    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6853  -17.2619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5012  -17.1748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8297  -16.4233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3417  -15.7595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5214  -15.8522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1966  -16.6040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0353  -15.1912    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3612  -14.4377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8751  -13.7766    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1772  -14.3452    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2010  -13.0231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7108  -12.3662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0170  -12.9306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6031  -12.3115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  5 10  1  0
  1 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 20  2  0
 23 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 29 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  2  0
 33 35  1  0
 35 36  1  0
 35 37  1  0
 35 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4277593

    ---

Associated Targets(Human)

HDAC3 Tclin Histone deacetylase 3/Nuclear receptor corepressor 2 (HDAC3/NCoR2) (735 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 537.69Molecular Weight (Monoisotopic): 537.2410AlogP: 6.66#Rotatable Bonds: 11
Polar Surface Area: 135.44Molecular Species: NEUTRALHBA: 7HBD: 4
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.96CX Basic pKa: 3.45CX LogP: 5.71CX LogD: 5.61
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.16Np Likeness Score: -1.43

References

1. Adhikari N, Amin SA, Trivedi P, Jha T, Ghosh B..  (2018)  HDAC3 is a potential validated target for cancer: An overview on the benzamide-based selective HDAC3 inhibitors through comparative SAR/QSAR/QAAR approaches.,  157  [PMID:30179749] [10.1016/j.ejmech.2018.08.081]

Source