The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-((2-Ethyl-6-(4-hydroxyphenyl)-3H-imidazo[4,5-b]pyridin-7-yl)oxy)-3-fluorophenyl)-1-(4-fluoro-phenyl)-2-oxo-1,2-dihydropyridine-3-carboxamide ID: ALA4277630
PubChem CID: 145986070
Max Phase: Preclinical
Molecular Formula: C32H23F2N5O4
Molecular Weight: 579.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCc1nc2c(Oc3ccc(NC(=O)c4cccn(-c5ccc(F)cc5)c4=O)cc3F)c(-c3ccc(O)cc3)cnc2[nH]1
Standard InChI: InChI=1S/C32H23F2N5O4/c1-2-27-37-28-29(24(17-35-30(28)38-27)18-5-12-22(40)13-6-18)43-26-14-9-20(16-25(26)34)36-31(41)23-4-3-15-39(32(23)42)21-10-7-19(33)8-11-21/h3-17,40H,2H2,1H3,(H,36,41)(H,35,37,38)
Standard InChI Key: ILCNJCKMKOAWPY-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
4.5963 -22.3407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5952 -23.1602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3032 -23.5692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3014 -21.9318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0100 -22.3371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0148 -23.1557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7949 -23.4041 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2722 -22.7390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7871 -22.0796 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2990 -21.1146 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0055 -20.7039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7123 -21.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4183 -20.7027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4163 -19.8847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7024 -19.4784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9993 -19.8907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2887 -19.4872 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.1222 -19.4730 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8317 -19.8786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5376 -19.4669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8352 -20.6957 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2443 -19.8736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9498 -19.4626 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9467 -18.6446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2323 -18.2392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5297 -18.6525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2465 -20.6908 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6591 -19.8685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6598 -20.6867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3682 -21.0925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0754 -20.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0696 -19.8598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3606 -19.4577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7852 -21.0861 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.8885 -21.9322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0894 -22.7342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5022 -23.4395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8917 -21.1141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1847 -20.7057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4762 -21.1146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4790 -21.9360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1865 -22.3406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7678 -20.7071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
4 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
16 17 1 0
14 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 20 2 0
22 27 2 0
23 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
1 35 1 0
8 36 1 0
36 37 1 0
35 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 35 1 0
40 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 579.56Molecular Weight (Monoisotopic): 579.1718AlogP: 6.37#Rotatable Bonds: 7Polar Surface Area: 122.13Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.65CX Basic pKa: 2.73CX LogP: 5.31CX LogD: 5.31Aromatic Rings: 6Heavy Atoms: 43QED Weighted: 0.20Np Likeness Score: -1.33
References 1. Baladi T, Aziz J, Dufour F, Abet V, Stoven V, Radvanyi F, Poyer F, Wu TD, Guerquin-Kern JL, Bernard-Pierrot I, Garrido SM, Piguel S.. (2018) Design, synthesis, biological evaluation and cellular imaging of imidazo[4,5-b]pyridine derivatives as potent and selective TAM inhibitors., 26 (20): [PMID:30309671 ] [10.1016/j.bmc.2018.09.031 ]