The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2,4-difluorobenzyl)-1-(2-(2,4-difluorobenzyloxy)-2-(2,4-difluorophenyl)ethyl)-1H-1,2,4-triazol-4-ium chloride ID: ALA4277728
PubChem CID: 145982691
Max Phase: Preclinical
Molecular Formula: C24H18ClF6N3O
Molecular Weight: 478.42
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Fc1ccc(COC(Cn2c[n+](Cc3ccc(F)cc3F)cn2)c2ccc(F)cc2F)c(F)c1.[Cl-]
Standard InChI: InChI=1S/C24H18F6N3O.ClH/c25-17-3-1-15(21(28)7-17)10-32-13-31-33(14-32)11-24(20-6-5-19(27)9-23(20)30)34-12-16-2-4-18(26)8-22(16)29;/h1-9,13-14,24H,10-12H2;1H/q+1;/p-1
Standard InChI Key: WPNNPENOAIUPFS-UHFFFAOYSA-M
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
13.5830 -18.9750 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.6944 -19.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6933 -19.8501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4013 -20.2591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1110 -19.8497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1082 -19.0270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3995 -18.6218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4011 -21.0763 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.8143 -18.6158 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.3971 -17.8046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1036 -17.3939 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8125 -17.8003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5190 -17.3896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2260 -17.7983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9320 -17.3883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9300 -16.5703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2161 -16.1639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5130 -16.5763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2268 -18.6155 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.6360 -16.1586 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.6882 -17.3981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9841 -18.6260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9820 -17.8132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2083 -17.5640 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7322 -18.2229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2118 -18.8791 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2165 -19.6957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5110 -20.1082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8035 -19.7008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0985 -20.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1025 -20.9306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8174 -21.3351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5195 -20.9210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2312 -21.3227 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.3976 -21.3439 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
4 8 1 0
6 9 1 0
7 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
14 19 1 0
16 20 1 0
10 21 1 0
21 23 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 22 2 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
33 34 1 0
31 35 1 0
M CHG 2 1 -1 26 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 478.42Molecular Weight (Monoisotopic): 478.1349AlogP: 5.01#Rotatable Bonds: 8Polar Surface Area: 30.93Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 1.72CX LogD: 1.72Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.26Np Likeness Score: -0.72
References 1. Zhang Y, Damu GLV, Cui SF, Mi JL, Tangadanchu VKR, Zhou CH.. (2017) Discovery of potential antifungal triazoles: design, synthesis, biological evaluation, and preliminary antifungal mechanism exploration., 8 (8): [PMID:30108874 ] [10.1039/C7MD00112F ]