(S)-N-((R)-4-fluoro-2,3-dihydro-1H-inden-1-yl)-1-((S)-2-((S)-2-(methylamino)propanamido)-3-(4-nitrophenyl)propanoyl)pyrrolidine-2-carboxamide

ID: ALA4277802

PubChem CID: 145979112

Max Phase: Preclinical

Molecular Formula: C27H32FN5O5

Molecular Weight: 525.58

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN[C@@H](C)C(=O)N[C@@H](Cc1ccc([N+](=O)[O-])cc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H]1CCc2c(F)cccc21

Standard InChI:  InChI=1S/C27H32FN5O5/c1-16(29-2)25(34)31-23(15-17-8-10-18(11-9-17)33(37)38)27(36)32-14-4-7-24(32)26(35)30-22-13-12-19-20(22)5-3-6-21(19)28/h3,5-6,8-11,16,22-24,29H,4,7,12-15H2,1-2H3,(H,30,35)(H,31,34)/t16-,22+,23-,24-/m0/s1

Standard InChI Key:  HZUXFPDGVMNOOO-ZFIFVKQDSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
    5.9927   -9.7469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2110  -10.5368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0027  -10.7412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5768  -10.1567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3538   -9.3648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5625   -9.1641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0814  -11.9928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6592  -12.5706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3873  -12.1997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2595  -11.3925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4524  -11.2648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5412  -12.4023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2489  -11.9937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8335  -11.9937    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1257  -12.4023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5412  -13.2195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9566  -12.4023    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2489  -11.1765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6643  -11.9937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3720  -12.4023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6643  -11.1765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3720  -13.2195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5313  -13.3777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9237   -8.7751    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7019   -7.9886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7158   -8.9763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7684  -13.6706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1664  -13.8920    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9293  -13.5992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9574  -12.7620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1413  -12.8049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2502  -13.5249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6145  -14.0381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7417  -14.8433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5041  -15.1363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1398  -14.6181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0093  -13.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6429  -13.2987    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  7  1  0
 12 13  1  0
 12 14  1  0
 14 15  1  0
 12 16  1  6
 13 17  1  0
 13 18  2  0
 17 19  1  0
 19 20  1  0
 19 21  1  1
 21  2  1  0
 20  7  1  0
 20 22  2  0
  8 23  1  1
 24 25  2  0
 24 26  1  0
  5 24  1  0
 23 27  2  0
 23 28  1  0
 29 28  1  6
 29 33  1  0
 32 30  1  0
 30 31  1  0
 31 29  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 37 38  1  0
M  CHG  2  24   1  26  -1
M  END

Alternative Forms

  1. Parent:

    ALA4277802

    ---

Associated Targets(Human)

BIRC3 Tchem Baculoviral IAP repeat-containing protein 3 (320 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BIRC2 Tchem Baculoviral IAP repeat-containing protein 2 (984 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
XIAP Tchem Inhibitor of apoptosis protein 3 (3673 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 525.58Molecular Weight (Monoisotopic): 525.2387AlogP: 2.16#Rotatable Bonds: 9
Polar Surface Area: 133.68Molecular Species: BASEHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.92CX Basic pKa: 8.60CX LogP: 2.48CX LogD: 1.25
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.34Np Likeness Score: -0.83

References

1. Baggio C, Gambini L, Udompholkul P, Salem AF, Aronson A, Dona A, Troadec E, Pichiorri F, Pellecchia M..  (2018)  Design of Potent pan-IAP and Lys-Covalent XIAP Selective Inhibitors Using a Thermodynamics Driven Approach.,  61  (14): [PMID:29940121] [10.1021/acs.jmedchem.8b00810]

Source