2-(4-(ethylsulfonyl)phenyl)-N-(4-(1-(isoindolin-2-yl)-2-methyl-1-oxopropan-2-yl)phenyl)acetamide

ID: ALA4278285

PubChem CID: 145980027

Max Phase: Preclinical

Molecular Formula: C28H30N2O4S

Molecular Weight: 490.63

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(C(C)(C)C(=O)N3Cc4ccccc4C3)cc2)cc1

Standard InChI:  InChI=1S/C28H30N2O4S/c1-4-35(33,34)25-15-9-20(10-16-25)17-26(31)29-24-13-11-23(12-14-24)28(2,3)27(32)30-18-21-7-5-6-8-22(21)19-30/h5-16H,4,17-19H2,1-3H3,(H,29,31)

Standard InChI Key:  HXLFKSOYXHHJCW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   33.4718  -12.2826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4760  -13.0998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1816  -12.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1373  -12.3817    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.5500  -13.0916    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   40.9584  -12.3792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.1844  -13.5084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1833  -14.3279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8913  -14.7369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6010  -14.3274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5981  -13.5048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8895  -13.0995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3093  -14.7349    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.0164  -14.3252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7247  -14.7327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0151  -13.5080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.4318  -14.3230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1389  -14.7318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8454  -14.3228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8446  -13.5047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1313  -13.0974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4276  -13.5088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2600  -13.5006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9665  -13.0900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7690  -13.5087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0612  -13.1003    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.7692  -14.3259    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.9752  -12.2887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3144  -13.4339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7692  -12.8268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1753  -12.1223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7684  -11.4205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9555  -11.4219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5513  -12.1310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9605  -12.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  2  0
  6  5  2  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 20  5  1  0
  5 23  1  0
 23 24  1  0
  7  2  1  0
  2 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  1  0
 28 31  1  0
 29 26  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4278285

    ---

Associated Targets(Human)

RORC Tchem Nuclear receptor ROR-gamma (8495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rorc Nuclear receptor ROR-gamma (89407 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 490.63Molecular Weight (Monoisotopic): 490.1926AlogP: 4.48#Rotatable Bonds: 7
Polar Surface Area: 83.55Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.96CX Basic pKa: CX LogP: 4.25CX LogD: 4.25
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.53Np Likeness Score: -1.58

References

1. Sasaki Y, Odan M, Yamamoto S, Kida S, Ueyama A, Shimizu M, Haruna T, Watanabe A, Okuno T..  (2018)  Discovery of a potent orally bioavailable retinoic acid receptor-related orphan receptor-gamma-t (RORγt) inhibitor, S18-000003.,  28  (22): [PMID:30301676] [10.1016/j.bmcl.2018.09.032]

Source