The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(5-Chloro-1-methyl-2-(6,6,6-trifluorohexyl)-1Hindol-3-yl)-3-methyl-5-oxopentanoic Acid ID: ALA4278772
PubChem CID: 145982307
Max Phase: Preclinical
Molecular Formula: C21H25ClF3NO3
Molecular Weight: 431.88
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(CC(=O)O)CC(=O)c1c(CCCCCC(F)(F)F)n(C)c2ccc(Cl)cc12
Standard InChI: InChI=1S/C21H25ClF3NO3/c1-13(11-19(28)29)10-18(27)20-15-12-14(22)7-8-16(15)26(2)17(20)6-4-3-5-9-21(23,24)25/h7-8,12-13H,3-6,9-11H2,1-2H3,(H,28,29)
Standard InChI Key: QJQXCFTWJLJMSB-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
8.7109 -10.8706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7097 -11.6979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4245 -12.1108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4227 -10.4578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1380 -10.8669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1429 -11.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9304 -11.9442 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4123 -11.2726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9225 -10.6070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9963 -10.4583 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.1899 -12.7273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1729 -9.8209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9788 -9.6447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6173 -9.2111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2292 -8.8586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0351 -8.6823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6735 -8.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2855 -7.8963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0914 -7.7200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7298 -7.2864 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2081 -11.0539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9212 -11.4687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9186 -12.2937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6317 -12.7084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6291 -13.5334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3422 -13.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3396 -14.7731 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.0580 -13.5379 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.0539 -14.3580 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
1 10 1 0
7 11 1 0
9 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
15 16 1 0
15 17 1 0
16 18 1 0
18 19 1 0
18 20 2 0
8 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.88Molecular Weight (Monoisotopic): 431.1475AlogP: 6.18#Rotatable Bonds: 10Polar Surface Area: 59.30Molecular Species: ACIDHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.35CX Basic pKa: ┄CX LogP: 5.70CX LogD: 2.78Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.36Np Likeness Score: -0.27
References 1. Chourey S, Ye Q, Reddy CN, Wang R, Cossette C, Gravel S, Slobodchikova I, Vuckovic D, Rokach J, Powell WS.. (2018) Novel Highly Potent and Metabolically Resistant Oxoeicosanoid (OXE) Receptor Antagonists That Block the Actions of the Granulocyte Chemoattractant 5-Oxo-6,8,11,14-Eicosatetraenoic Acid (5-oxo-ETE)., 61 (14): [PMID:29972644 ] [10.1021/acs.jmedchem.8b00154 ]