The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(3-(4-(N-methylacetamido)phenyl)pentan-3-yl)phenyl azocane-1-carboxylate ID: ALA427881
PubChem CID: 44441809
Max Phase: Preclinical
Molecular Formula: C28H38N2O3
Molecular Weight: 450.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC(CC)(c1ccc(OC(=O)N2CCCCCCC2)cc1)c1ccc(N(C)C(C)=O)cc1
Standard InChI: InChI=1S/C28H38N2O3/c1-5-28(6-2,23-12-16-25(17-13-23)29(4)22(3)31)24-14-18-26(19-15-24)33-27(32)30-20-10-8-7-9-11-21-30/h12-19H,5-11,20-21H2,1-4H3
Standard InChI Key: BHHTXNSLCXJWDG-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
-3.1139 -16.9166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1151 -17.7440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4003 -18.1569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6838 -17.7435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6867 -16.9130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4021 -16.5039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9738 -16.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2578 -16.9076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2580 -17.7303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4572 -18.1400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1711 -17.7247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1653 -16.8955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4495 -16.4895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8876 -18.1336 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6000 -17.7175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3166 -18.1263 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5958 -16.8925 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2625 -16.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6917 -16.0833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8299 -18.1559 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.5440 -17.7429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8305 -18.9809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5434 -16.9179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2588 -18.1548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2667 -15.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6958 -15.2583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9745 -17.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7908 -17.7245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2177 -18.9446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7245 -19.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5409 -19.7013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 -19.1944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2978 -18.3780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15 16 1 0
7 8 1 0
15 17 2 0
7 18 1 0
8 9 2 0
7 19 1 0
4 5 1 0
2 20 1 0
9 10 1 0
20 21 1 0
2 3 1 0
20 22 1 0
10 11 2 0
21 23 1 0
5 6 2 0
21 24 2 0
11 12 1 0
18 25 1 0
6 1 1 0
19 26 1 0
12 13 2 0
13 8 1 0
1 2 2 0
11 14 1 0
5 7 1 0
14 15 1 0
3 4 2 0
16 27 1 0
27 28 1 0
16 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 450.62Molecular Weight (Monoisotopic): 450.2882AlogP: 6.54#Rotatable Bonds: 6Polar Surface Area: 49.85Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.10CX LogD: 6.10Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: -0.86
References 1. Hosoda S, Hashimoto Y.. (2007) 3,3-diphenylpentane skeleton as a steroid skeleton substitute: novel inhibitors of human 5alpha-reductase 1., 17 (19): [PMID:17686629 ] [10.1016/j.bmcl.2007.07.039 ]