2-(4-(2-(4-(ethylsulfonyl)phenyl)acetamido)phenyl)-2-methyl-N-phenylpropanamide

ID: ALA4279420

PubChem CID: 134821990

Max Phase: Preclinical

Molecular Formula: C26H28N2O4S

Molecular Weight: 464.59

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(C(C)(C)C(=O)Nc3ccccc3)cc2)cc1

Standard InChI:  InChI=1S/C26H28N2O4S/c1-4-33(31,32)23-16-10-19(11-17-23)18-24(29)27-22-14-12-20(13-15-22)26(2,3)25(30)28-21-8-6-5-7-9-21/h5-17H,4,18H2,1-3H3,(H,27,29)(H,28,30)

Standard InChI Key:  QECSHZAJHGHAOA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   33.2159   -7.0534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2201   -7.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9257   -7.4585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8814   -7.1525    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.2941   -7.8624    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   40.7025   -7.1500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.9285   -8.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9274   -9.0987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6354   -9.5077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3451   -9.0982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3423   -8.2756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6336   -7.8703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0534   -9.5057    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.7605   -9.0960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4689   -9.5035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7592   -8.2788    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.1759   -9.0938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8830   -9.5026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5896   -9.0936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5887   -8.2755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8754   -7.8682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1717   -8.2796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0041   -8.2714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7107   -7.8608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5131   -8.2795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8053   -7.8711    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.5133   -9.0967    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.0977   -8.2799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3904   -7.8697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6833   -8.2778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6830   -9.0958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3958   -9.5041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1000   -9.0937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  2  0
  6  5  2  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 20  5  1  0
  5 23  1  0
 23 24  1  0
  7  2  1  0
  2 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4279420

    ---

Associated Targets(Human)

RORC Tchem Nuclear receptor ROR-gamma (8495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rorc Nuclear receptor ROR-gamma (89407 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 464.59Molecular Weight (Monoisotopic): 464.1770AlogP: 4.58#Rotatable Bonds: 8
Polar Surface Area: 92.34Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.51CX Basic pKa: CX LogP: 4.57CX LogD: 4.57
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.51Np Likeness Score: -1.57

References

1. Sasaki Y, Odan M, Yamamoto S, Kida S, Ueyama A, Shimizu M, Haruna T, Watanabe A, Okuno T..  (2018)  Discovery of a potent orally bioavailable retinoic acid receptor-related orphan receptor-gamma-t (RORγt) inhibitor, S18-000003.,  28  (22): [PMID:30301676] [10.1016/j.bmcl.2018.09.032]

Source