2-[(3R,7R,11S)-3,16-dihydroxy-3,7,11,15-tetramethyl-hexadecyl]-6-methyl-3,5-bis(trideuteriomethyl)-1,4-benzoquinone

ID: ALA4279647

PubChem CID: 145978967

Max Phase: Preclinical

Molecular Formula: C29H50O4

Molecular Weight: 462.72

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  [2H]C([2H])([2H])C1=C(C)C(=O)C(CC[C@](C)(O)CCC[C@H](C)CCC[C@H](C)CCCC(C)CO)=C(C([2H])([2H])[2H])C1=O

Standard InChI:  InChI=1S/C29H50O4/c1-20(13-9-14-22(3)19-30)11-8-12-21(2)15-10-17-29(7,33)18-16-26-25(6)27(31)23(4)24(5)28(26)32/h20-22,30,33H,8-19H2,1-7H3/t20-,21+,22?,29+/m0/s1/i4D3,6D3

Standard InChI Key:  PNZFXYAIKWIOSQ-IJJWWHCNSA-N

Molfile:  

     RDKit          2D

 39 39  0  0  0  0  0  0  0  0999 V2000
   18.5900  -12.5937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9295  -13.3937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2926  -13.8251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2179  -13.8041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5088  -13.3896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2727  -15.8252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6859  -12.6749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5067  -12.6724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6345  -13.8084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2727  -15.0085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9765  -13.7916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2727  -13.3749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0943  -13.3832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6821  -15.0136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6839  -13.3812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1669  -13.4063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5876  -13.4105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5606  -13.7916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0469  -13.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8532  -13.3812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5606  -14.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7543  -13.4021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4594  -13.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9319  -12.5770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3419  -13.3980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8013  -13.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7568  -12.5853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9765  -14.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3889  -13.7958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8801  -13.8209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747  -12.5578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9835  -12.1510    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5681  -12.1474    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.2680  -11.7378    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8553  -15.0211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1452  -14.6166    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8601  -15.8383    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1425  -15.4235    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.2926  -14.6501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 19 22  1  0
 28 14  2  0
 23 16  1  0
 11 15  1  0
 15 29  1  0
 22 27  1  6
 21 10  2  0
 11 12  2  0
 16 30  1  0
 13 26  1  0
 18 20  2  0
 26  5  1  0
  2 24  1  6
 10 28  1  0
 28 11  1  0
 17  3  1  0
 30 17  1  0
 25 19  1  0
  8 13  1  0
 17  1  1  0
 22 23  1  0
  2  9  1  0
 18 12  1  0
  4  2  1  0
  5  4  1  0
 13  7  1  1
 29 13  1  0
 10  6  1  0
 18 21  1  0
  9 25  1  0
 12 31  1  0
 31 32  1  0
 31 33  1  0
 31 34  1  0
 21 35  1  0
 35 36  1  0
 35 37  1  0
 35 38  1  0
  3 39  1  0
M  ISO  6  32   2  33   2  34   2  36   2  37   2  38   2
M  END

Associated Targets(Human)

CYP4F2 Tchem Cytochrome P450 4F2 (83 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 462.72Molecular Weight (Monoisotopic): 462.3709AlogP: 6.73#Rotatable Bonds: 16
Polar Surface Area: 74.60Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 7.67CX LogD: 7.67
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.25Np Likeness Score: 1.26

References

1. Taylor L, Krueger N, Malysheva O, Atkinson J, Parker RS..  (2018)  ω-Hydroxylation of α-tocopheryl quinone reveals a dual function for cytochrome P450-4F2 in vitamin E metabolism.,  26  (20): [PMID:30316641] [10.1016/j.bmc.2018.10.002]

Source