The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-fluoro-4-((6-phenyl-3H-imidazo[4,5-b]pyridin-7-yl)oxy)phenyl)-1-(4-fluorophenyl)-2-oxo-1,2-dihydropyridine-3-carboxamide ID: ALA4279970
PubChem CID: 145980994
Max Phase: Preclinical
Molecular Formula: C30H19F2N5O3
Molecular Weight: 535.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(Oc2c(-c3ccccc3)cnc3[nH]cnc23)c(F)c1)c1cccn(-c2ccc(F)cc2)c1=O
Standard InChI: InChI=1S/C30H19F2N5O3/c31-19-8-11-21(12-9-19)37-14-4-7-22(30(37)39)29(38)36-20-10-13-25(24(32)15-20)40-27-23(18-5-2-1-3-6-18)16-33-28-26(27)34-17-35-28/h1-17H,(H,36,38)(H,33,34,35)
Standard InChI Key: PZXJIXMESZPGEM-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
31.4150 -21.4492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4139 -22.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1219 -22.6777 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.1202 -21.0403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8288 -21.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8336 -22.2642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6136 -22.5126 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.0910 -21.8475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6059 -21.1881 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.1177 -20.2231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.8242 -19.8124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5310 -20.2213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2370 -19.8112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2350 -18.9932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5211 -18.5869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8180 -18.9992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1074 -18.5958 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
34.9410 -18.5815 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.6504 -18.9871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3564 -18.5754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6540 -19.8043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.0631 -18.9821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7685 -18.5712 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.7654 -17.7531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0510 -17.3477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3485 -17.7610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0652 -19.7993 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.4778 -18.9770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4785 -19.7953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1870 -20.2011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8941 -19.7897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8883 -18.9683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1793 -18.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6039 -20.1946 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.7072 -21.0407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7105 -20.2226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0035 -19.8143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2949 -20.2231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2977 -21.0445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0053 -21.4492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
4 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
16 17 1 0
14 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 20 2 0
22 27 2 0
23 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
1 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 535.51Molecular Weight (Monoisotopic): 535.1456AlogP: 6.10#Rotatable Bonds: 6Polar Surface Area: 101.90Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.49CX Basic pKa: 2.47CX LogP: 4.79CX LogD: 4.79Aromatic Rings: 6Heavy Atoms: 40QED Weighted: 0.27Np Likeness Score: -1.39
References 1. Baladi T, Aziz J, Dufour F, Abet V, Stoven V, Radvanyi F, Poyer F, Wu TD, Guerquin-Kern JL, Bernard-Pierrot I, Garrido SM, Piguel S.. (2018) Design, synthesis, biological evaluation and cellular imaging of imidazo[4,5-b]pyridine derivatives as potent and selective TAM inhibitors., 26 (20): [PMID:30309671 ] [10.1016/j.bmc.2018.09.031 ]