The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(2-(1-(2,4-difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethoxy)ethoxy)-4-methyl-2H-chromen-2-one ID: ALA4280232
PubChem CID: 145981223
Max Phase: Preclinical
Molecular Formula: C22H19F2N3O4
Molecular Weight: 427.41
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(=O)oc2cc(OCCOC(Cn3cncn3)c3ccc(F)cc3F)ccc12
Standard InChI: InChI=1S/C22H19F2N3O4/c1-14-8-22(28)31-20-10-16(3-5-17(14)20)29-6-7-30-21(11-27-13-25-12-26-27)18-4-2-15(23)9-19(18)24/h2-5,8-10,12-13,21H,6-7,11H2,1H3
Standard InChI Key: QHLGTQSOGJOHSC-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
4.2331 -12.4105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2320 -13.2301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9400 -13.6390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6497 -13.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6469 -12.4069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9382 -12.0017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9398 -14.4562 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.3530 -11.9957 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.9358 -11.1845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6423 -10.7738 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3512 -11.1803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2269 -10.7780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5228 -12.0059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5206 -11.1931 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7470 -10.9440 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2709 -11.6028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7505 -12.2591 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0577 -10.7696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7666 -11.1760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4731 -10.7653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1803 -11.1739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1704 -9.5395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4673 -9.9519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8843 -9.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8846 -10.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5892 -11.1703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2981 -10.7634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2978 -9.9454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5887 -9.5343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5873 -8.7171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0054 -11.1727 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
5 8 1 0
6 9 1 0
9 10 1 0
10 11 1 0
9 12 1 0
12 14 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 13 2 0
11 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 25 1 0
24 22 1 0
22 23 2 0
23 20 1 0
24 25 2 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
27 31 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 427.41Molecular Weight (Monoisotopic): 427.1344AlogP: 3.81#Rotatable Bonds: 8Polar Surface Area: 79.38Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.01CX LogP: 3.49CX LogD: 3.49Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.31Np Likeness Score: -1.25
References 1. Zhang Y, Damu GLV, Cui SF, Mi JL, Tangadanchu VKR, Zhou CH.. (2017) Discovery of potential antifungal triazoles: design, synthesis, biological evaluation, and preliminary antifungal mechanism exploration., 8 (8): [PMID:30108874 ] [10.1039/C7MD00112F ]