The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-((2-Ethyl-6-(furan-3-yl)-3H-imidazo[4,5-b]pyridin-7-yl)oxy)-3-fluorophenyl)-1-(4-fluorophenyl)-2-oxo-1,2-dihydropyridine-3-carboxamide ID: ALA4280621
PubChem CID: 145979452
Max Phase: Preclinical
Molecular Formula: C30H21F2N5O4
Molecular Weight: 553.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCc1nc2c(Oc3ccc(NC(=O)c4cccn(-c5ccc(F)cc5)c4=O)cc3F)c(-c3ccoc3)cnc2[nH]1
Standard InChI: InChI=1S/C30H21F2N5O4/c1-2-25-35-26-27(22(15-33-28(26)36-25)17-11-13-40-16-17)41-24-10-7-19(14-23(24)32)34-29(38)21-4-3-12-37(30(21)39)20-8-5-18(31)6-9-20/h3-16H,2H2,1H3,(H,34,38)(H,33,35,36)
Standard InChI Key: MIHMNABBTHGCER-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
15.8471 -5.4273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8460 -6.2468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5540 -6.6558 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5523 -5.0184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2609 -5.4237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2657 -6.2423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0457 -6.4907 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5231 -5.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0379 -5.1662 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5498 -4.2012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2563 -3.7905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9631 -4.1994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6691 -3.7893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6671 -2.9713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9532 -2.5650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2501 -2.9773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5395 -2.5739 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.3731 -2.5596 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0825 -2.9652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7885 -2.5535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0860 -3.7824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4952 -2.9602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2006 -2.5492 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.1975 -1.7312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4831 -1.3258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7806 -1.7391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4973 -3.7774 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.9099 -2.9551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9106 -3.7734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6191 -4.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3262 -3.7678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3204 -2.9464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6114 -2.5443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0360 -4.1727 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.1393 -5.0188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3402 -5.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7530 -6.5261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0537 -4.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2543 -4.0372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8458 -4.7451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3929 -5.3521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
4 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
16 17 1 0
14 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 20 2 0
22 27 2 0
23 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
1 35 1 0
8 36 1 0
36 37 1 0
35 38 1 0
38 39 2 0
39 40 1 0
40 41 1 0
41 35 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 553.53Molecular Weight (Monoisotopic): 553.1562AlogP: 6.25#Rotatable Bonds: 7Polar Surface Area: 115.04Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.75CX Basic pKa: 2.73CX LogP: 4.75CX LogD: 4.75Aromatic Rings: 6Heavy Atoms: 41QED Weighted: 0.24Np Likeness Score: -1.42
References 1. Baladi T, Aziz J, Dufour F, Abet V, Stoven V, Radvanyi F, Poyer F, Wu TD, Guerquin-Kern JL, Bernard-Pierrot I, Garrido SM, Piguel S.. (2018) Design, synthesis, biological evaluation and cellular imaging of imidazo[4,5-b]pyridine derivatives as potent and selective TAM inhibitors., 26 (20): [PMID:30309671 ] [10.1016/j.bmc.2018.09.031 ]