5-(6-Chloro-2-(3-phenylpropyl)-1H-indol-1-yl)-3-methyl-5-oxopentanoic Acid

ID: ALA4280693

PubChem CID: 145979016

Max Phase: Preclinical

Molecular Formula: C23H24ClNO3

Molecular Weight: 397.90

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(CC(=O)O)CC(=O)n1c(CCCc2ccccc2)cc2ccc(Cl)cc21

Standard InChI:  InChI=1S/C23H24ClNO3/c1-16(13-23(27)28)12-22(26)25-20(9-5-8-17-6-3-2-4-7-17)14-18-10-11-19(24)15-21(18)25/h2-4,6-7,10-11,14-16H,5,8-9,12-13H2,1H3,(H,27,28)

Standard InChI Key:  ZYYIVSOEOXPYEG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   20.3473  -11.8928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7695  -11.3149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9801  -11.5264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4023  -10.9486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6130  -11.1601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1367  -11.6813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1358  -12.6821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3604  -11.9373    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7686  -12.3158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0661  -10.5528    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2534  -10.6382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9211   -9.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5283   -9.3449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5283   -8.5277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2361   -8.1191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9438   -8.5277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9438   -9.3449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2361   -9.7535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8448  -11.3459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0276  -11.3459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6191  -12.0537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8019  -12.0537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3933  -12.7614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5761  -12.7614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1675  -12.0537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5761  -11.3459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3933  -11.3459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6515   -8.1191    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  1  6  2  0
  1  7  1  0
  5  8  2  0
  3  9  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 10 18  1  0
 13 18  2  0
 19 20  1  0
 20 21  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 22 27  2  0
 21 22  1  0
 11 19  1  0
 16 28  1  0
  5 10  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4280693

    ---

Associated Targets(Human)

OXER1 Tchem Oxoeicosanoid receptor 1 (131 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 397.90Molecular Weight (Monoisotopic): 397.1445AlogP: 5.61#Rotatable Bonds: 8
Polar Surface Area: 59.30Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.26CX Basic pKa: CX LogP: 5.30CX LogD: 2.30
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.54Np Likeness Score: -0.25

References

1. Chourey S, Ye Q, Reddy CN, Wang R, Cossette C, Gravel S, Slobodchikova I, Vuckovic D, Rokach J, Powell WS..  (2018)  Novel Highly Potent and Metabolically Resistant Oxoeicosanoid (OXE) Receptor Antagonists That Block the Actions of the Granulocyte Chemoattractant 5-Oxo-6,8,11,14-Eicosatetraenoic Acid (5-oxo-ETE).,  61  (14): [PMID:29972644] [10.1021/acs.jmedchem.8b00154]

Source