The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(2,4-dimethoxyphenylsulfonyl)-3-(2-ethoxy-5-methoxyphenyl)-2-oxo-3-(4-(pyridin-4-yl)piperazin-1-yl)indoline-5-carbonitrile ID: ALA4281537
PubChem CID: 68903270
Max Phase: Preclinical
Molecular Formula: C35H35N5O7S
Molecular Weight: 669.76
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1ccc(OC)cc1C1(N2CCN(c3ccncc3)CC2)C(=O)N(S(=O)(=O)c2ccc(OC)cc2OC)c2ccc(C#N)cc21
Standard InChI: InChI=1S/C35H35N5O7S/c1-5-47-31-10-7-26(44-2)21-29(31)35(39-18-16-38(17-19-39)25-12-14-37-15-13-25)28-20-24(23-36)6-9-30(28)40(34(35)41)48(42,43)33-11-8-27(45-3)22-32(33)46-4/h6-15,20-22H,5,16-19H2,1-4H3
Standard InChI Key: QPXVFJHPKHOWAH-UHFFFAOYSA-N
Molfile:
RDKit 2D
48 53 0 0 0 0 0 0 0 0999 V2000
14.5936 -13.4060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5936 -14.2232 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2989 -14.6276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0042 -14.2232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0042 -13.4060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2989 -12.9933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6983 -13.8303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7024 -14.6475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6723 -16.3356 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9665 -16.7483 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.6768 -17.1531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5135 -14.9116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5124 -15.7312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2204 -16.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2187 -14.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8057 -14.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9273 -14.9080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9321 -15.7267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7121 -15.9751 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1895 -15.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0066 -15.3052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4259 -17.3613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3411 -18.5799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1460 -18.7434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6856 -18.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4062 -13.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4025 -12.6036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6921 -12.1977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9842 -12.6143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9914 -13.4294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2871 -13.8438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5761 -13.4411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7131 -12.9995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4157 -13.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1241 -13.0075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1270 -12.1894 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4155 -11.7789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7100 -12.1871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0842 -17.8032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6266 -17.1948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0979 -14.0948 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4866 -18.2942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7470 -19.0688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7986 -19.1911 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9981 -19.0269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1083 -12.1918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1046 -11.3746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5693 -12.6239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
8 7 1 0
10 9 2 0
11 10 2 0
12 13 2 0
13 14 1 0
14 18 2 0
17 15 2 0
15 12 1 0
12 16 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 8 1 0
8 17 1 0
20 21 2 0
19 10 1 0
10 22 1 0
22 40 2 0
39 23 2 0
23 24 1 0
24 25 2 0
25 22 1 0
7 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 7 1 0
30 31 1 0
31 32 1 0
8 2 1 0
5 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
39 40 1 0
16 41 3 0
25 42 1 0
42 43 1 0
23 44 1 0
44 45 1 0
27 46 1 0
46 47 1 0
32 48 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 669.76Molecular Weight (Monoisotopic): 669.2257AlogP: 4.18#Rotatable Bonds: 10Polar Surface Area: 134.53Molecular Species: BASEHBA: 11HBD: ┄#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.70CX LogP: 4.07CX LogD: 3.23Aromatic Rings: 4Heavy Atoms: 48QED Weighted: 0.24Np Likeness Score: -0.94
References 1. Geneste H, Bhowmik S, van Gaalen MM, Hornberger W, Hutchins CW, Netz A, Oost T, Unger L.. (2018) Novel, potent, selective and brain penetrant vasopressin 1b receptor antagonists., 28 (19): [PMID:30098866 ] [10.1016/j.bmcl.2018.07.043 ]