The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-chloro-3-(2-methoxypyridin-3-yl)-3-(4-(pyridin-3-yl)piperazin-1-yl)-1-(quinolin-8-ylsulfonyl)indolin-2-one ID: ALA4281615
PubChem CID: 145981524
Max Phase: Preclinical
Molecular Formula: C32H27ClN6O4S
Molecular Weight: 627.13
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ncccc1C1(N2CCN(c3cccnc3)CC2)C(=O)N(S(=O)(=O)c2cccc3cccnc23)c2ccc(Cl)cc21
Standard InChI: InChI=1S/C32H27ClN6O4S/c1-43-30-25(9-5-15-36-30)32(38-18-16-37(17-19-38)24-8-4-13-34-21-24)26-20-23(33)11-12-27(26)39(31(32)40)44(41,42)28-10-2-6-22-7-3-14-35-29(22)28/h2-15,20-21H,16-19H2,1H3
Standard InChI Key: VDTJCIRWCRGMPT-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 50 0 0 0 0 0 0 0 0999 V2000
43.6534 -13.3482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6534 -14.1654 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.3587 -14.5699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.0640 -14.1654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.0640 -13.3482 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.3587 -12.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7581 -13.7726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7622 -14.5898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7321 -16.2778 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.0264 -16.6905 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
43.7367 -17.0954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.5734 -14.8539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5722 -15.6734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2803 -16.0824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2785 -14.4450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8656 -14.4454 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
41.9871 -14.8503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9919 -15.6689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7719 -15.9173 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.2493 -15.2522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0665 -15.2474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.4857 -17.3035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4009 -18.5221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2059 -18.6856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7454 -18.0747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4660 -13.3622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4623 -12.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7520 -12.1400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0440 -12.5565 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.0512 -13.3716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3469 -13.7860 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.6359 -13.3833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.7729 -12.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.4755 -13.3555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.1839 -12.9497 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
47.1868 -12.1316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.4753 -11.7211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.7698 -12.1293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1440 -17.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6864 -17.1370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4304 -16.3651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.6324 -16.2004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0908 -16.8138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3497 -17.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
8 7 1 0
10 9 2 0
11 10 2 0
12 13 2 0
13 14 1 0
14 18 2 0
17 15 2 0
15 12 1 0
12 16 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 8 1 0
8 17 1 0
20 21 2 0
19 10 1 0
10 22 1 0
22 40 2 0
39 23 2 0
23 24 1 0
24 25 2 0
25 22 1 0
7 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 7 1 0
30 31 1 0
31 32 1 0
8 2 1 0
5 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
39 40 1 0
40 41 1 0
41 42 2 0
42 43 1 0
43 44 2 0
44 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 627.13Molecular Weight (Monoisotopic): 626.1503AlogP: 4.49#Rotatable Bonds: 6Polar Surface Area: 108.83Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.58CX LogP: 4.47CX LogD: 4.46Aromatic Rings: 5Heavy Atoms: 44QED Weighted: 0.27Np Likeness Score: -1.13
References 1. Geneste H, Bhowmik S, van Gaalen MM, Hornberger W, Hutchins CW, Netz A, Oost T, Unger L.. (2018) Novel, potent, selective and brain penetrant vasopressin 1b receptor antagonists., 28 (19): [PMID:30098866 ] [10.1016/j.bmcl.2018.07.043 ]