2-(4-(2-(4-(ethylsulfonyl)phenyl)acetamido)phenyl)-N-(3-fluorophenyl)-2-methylpropanamide

ID: ALA4281750

PubChem CID: 145979726

Max Phase: Preclinical

Molecular Formula: C26H27FN2O4S

Molecular Weight: 482.58

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(C(C)(C)C(=O)Nc3cccc(F)c3)cc2)cc1

Standard InChI:  InChI=1S/C26H27FN2O4S/c1-4-34(32,33)23-14-8-18(9-15-23)16-24(30)28-21-12-10-19(11-13-21)26(2,3)25(31)29-22-7-5-6-20(27)17-22/h5-15,17H,4,16H2,1-3H3,(H,28,30)(H,29,31)

Standard InChI Key:  IKKTYHVOFCDTIW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
   19.4062  -17.2353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4104  -18.0525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1160  -17.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0717  -17.3344    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.4844  -18.0442    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   26.8928  -17.3319    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1188  -18.4611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1177  -19.2806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8257  -19.6896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5354  -19.2801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5326  -18.4575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8239  -18.0522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2437  -19.6876    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.9508  -19.2779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6591  -19.6854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9495  -18.4607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.3662  -19.2757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0733  -19.6845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7799  -19.2755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7790  -18.4574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0657  -18.0501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3620  -18.4615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1944  -18.4533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9009  -18.0427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7034  -18.4614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9956  -18.0530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.7036  -19.2786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2880  -18.4617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5807  -18.0515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8736  -18.4596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8733  -19.2777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5861  -19.6860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2903  -19.2755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5892  -20.5031    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  2  0
  6  5  2  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 20  5  1  0
  5 23  1  0
 23 24  1  0
  7  2  1  0
  2 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 32 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4281750

    ---

Associated Targets(Human)

RORC Tchem Nuclear receptor ROR-gamma (8495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rorc Nuclear receptor ROR-gamma (89407 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 482.58Molecular Weight (Monoisotopic): 482.1676AlogP: 4.72#Rotatable Bonds: 8
Polar Surface Area: 92.34Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.12CX Basic pKa: CX LogP: 4.71CX LogD: 4.71
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.49Np Likeness Score: -1.90

References

1. Sasaki Y, Odan M, Yamamoto S, Kida S, Ueyama A, Shimizu M, Haruna T, Watanabe A, Okuno T..  (2018)  Discovery of a potent orally bioavailable retinoic acid receptor-related orphan receptor-gamma-t (RORγt) inhibitor, S18-000003.,  28  (22): [PMID:30301676] [10.1016/j.bmcl.2018.09.032]

Source