The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(1-(azetidin-1-yl)-2-methyl-1-oxopropan-2-yl)phenyl)-2-(4-(ethylsulfonyl)phenyl)acetamide ID: ALA4282063
PubChem CID: 145981784
Max Phase: Preclinical
Molecular Formula: C23H28N2O4S
Molecular Weight: 428.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(C(C)(C)C(=O)N3CCC3)cc2)cc1
Standard InChI: InChI=1S/C23H28N2O4S/c1-4-30(28,29)20-12-6-17(7-13-20)16-21(26)24-19-10-8-18(9-11-19)23(2,3)22(27)25-14-5-15-25/h6-13H,4-5,14-16H2,1-3H3,(H,24,26)
Standard InChI Key: ZIIYCIXZMYHIDE-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
36.8355 -1.7912 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.2482 -2.5011 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
37.6567 -1.7887 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.7614 -1.7995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1742 -2.5094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5826 -1.7970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8826 -2.9179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8815 -3.7374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5895 -4.1464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2992 -3.7370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2964 -2.9143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5877 -2.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0075 -4.1445 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7146 -3.7348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4230 -4.1422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7133 -2.9176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.1300 -3.7325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8371 -4.1414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5437 -3.7323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5428 -2.9143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8295 -2.5070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1258 -2.9183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9582 -2.9102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6648 -2.4995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4672 -2.9183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7594 -2.5098 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.4674 -3.7354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.5477 -1.7164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7584 -1.9281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9701 -2.7174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 1 0
6 5 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
10 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
20 2 1 0
2 23 1 0
23 24 1 0
7 5 1 0
5 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 1 0
29 30 1 0
30 26 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 428.55Molecular Weight (Monoisotopic): 428.1770AlogP: 3.17#Rotatable Bonds: 7Polar Surface Area: 83.55Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.96CX Basic pKa: ┄CX LogP: 2.66CX LogD: 2.66Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.73Np Likeness Score: -1.86
References 1. Sasaki Y, Odan M, Yamamoto S, Kida S, Ueyama A, Shimizu M, Haruna T, Watanabe A, Okuno T.. (2018) Discovery of a potent orally bioavailable retinoic acid receptor-related orphan receptor-gamma-t (RORγt) inhibitor, S18-000003., 28 (22): [PMID:30301676 ] [10.1016/j.bmcl.2018.09.032 ]