N-(4-(1-(azetidin-1-yl)-2-methyl-1-oxopropan-2-yl)phenyl)-2-(4-(ethylsulfonyl)phenyl)acetamide

ID: ALA4282063

PubChem CID: 145981784

Max Phase: Preclinical

Molecular Formula: C23H28N2O4S

Molecular Weight: 428.55

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(C(C)(C)C(=O)N3CCC3)cc2)cc1

Standard InChI:  InChI=1S/C23H28N2O4S/c1-4-30(28,29)20-12-6-17(7-13-20)16-21(26)24-19-10-8-18(9-11-19)23(2,3)22(27)25-14-5-15-25/h6-13H,4-5,14-16H2,1-3H3,(H,24,26)

Standard InChI Key:  ZIIYCIXZMYHIDE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   36.8355   -1.7912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.2482   -2.5011    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   37.6567   -1.7887    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.7614   -1.7995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1742   -2.5094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5826   -1.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8826   -2.9179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8815   -3.7374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5895   -4.1464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2992   -3.7370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2964   -2.9143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5877   -2.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0075   -4.1445    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.7146   -3.7348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4230   -4.1422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7133   -2.9176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.1300   -3.7325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8371   -4.1414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5437   -3.7323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5428   -2.9143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8295   -2.5070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1258   -2.9183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9582   -2.9102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6648   -2.4995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4672   -2.9183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7594   -2.5098    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.4674   -3.7354    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5477   -1.7164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7584   -1.9281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9701   -2.7174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  1  0
  6  5  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 20  2  1  0
  2 23  1  0
 23 24  1  0
  7  5  1  0
  5 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  1  0
 28 29  1  0
 29 30  1  0
 30 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4282063

    ---

Associated Targets(Human)

RORC Tchem Nuclear receptor ROR-gamma (8495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rorc Nuclear receptor ROR-gamma (89407 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 428.55Molecular Weight (Monoisotopic): 428.1770AlogP: 3.17#Rotatable Bonds: 7
Polar Surface Area: 83.55Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.96CX Basic pKa: CX LogP: 2.66CX LogD: 2.66
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.73Np Likeness Score: -1.86

References

1. Sasaki Y, Odan M, Yamamoto S, Kida S, Ueyama A, Shimizu M, Haruna T, Watanabe A, Okuno T..  (2018)  Discovery of a potent orally bioavailable retinoic acid receptor-related orphan receptor-gamma-t (RORγt) inhibitor, S18-000003.,  28  (22): [PMID:30301676] [10.1016/j.bmcl.2018.09.032]

Source