The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(2-(2,4-difluorophenyl)-2-(4-nitrobenzyloxy)ethyl)-4-(4-nitrobenzyl)-1H-1,2,4-triazol-4-ium chloride ID: ALA4282255
PubChem CID: 145979298
Max Phase: Preclinical
Molecular Formula: C24H20ClF2N5O5
Molecular Weight: 496.45
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=[N+]([O-])c1ccc(COC(Cn2c[n+](Cc3ccc([N+](=O)[O-])cc3)cn2)c2ccc(F)cc2F)cc1.[Cl-]
Standard InChI: InChI=1S/C24H20F2N5O5.ClH/c25-19-5-10-22(23(26)11-19)24(36-14-18-3-8-21(9-4-18)31(34)35)13-29-16-28(15-27-29)12-17-1-6-20(7-2-17)30(32)33;/h1-11,15-16,24H,12-14H2;1H/q+1;/p-1
Standard InChI Key: KEZMEIYUWMZTOU-UHFFFAOYSA-M
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
24.4385 -18.4717 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
26.6398 -18.5353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6387 -19.3549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3467 -19.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0564 -19.3544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0536 -18.5317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3450 -18.1265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3465 -20.5810 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.7597 -18.1205 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.3425 -17.3093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0490 -16.8986 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.7579 -17.3051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4644 -16.8944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1714 -17.3031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8774 -16.8930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8754 -16.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1615 -15.6687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4584 -16.0810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6336 -16.9028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9295 -18.1307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9274 -17.3179 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1537 -17.0688 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.6776 -17.7277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1572 -18.3839 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1619 -19.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4564 -19.6129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7489 -19.2055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0439 -19.6172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0479 -20.4353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7628 -20.8399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4649 -20.4258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5814 -15.6633 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.2908 -16.0689 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.5778 -14.8462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.3430 -20.8487 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6326 -20.4449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.3485 -21.6659 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
4 8 1 0
6 9 1 0
7 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
10 19 1 0
19 21 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 20 2 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
16 32 1 0
32 33 1 0
32 34 2 0
29 35 1 0
35 36 1 0
35 37 2 0
M CHG 6 1 -1 24 1 32 1 33 -1 35 1 36 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.45Molecular Weight (Monoisotopic): 496.1427AlogP: 4.27#Rotatable Bonds: 10Polar Surface Area: 117.21Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 1.03CX LogD: 1.03Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.18Np Likeness Score: -0.95
References 1. Zhang Y, Damu GLV, Cui SF, Mi JL, Tangadanchu VKR, Zhou CH.. (2017) Discovery of potential antifungal triazoles: design, synthesis, biological evaluation, and preliminary antifungal mechanism exploration., 8 (8): [PMID:30108874 ] [10.1039/C7MD00112F ]