The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-chloro-1-(2,4-dimethoxyphenylsulfonyl)-3-(2-methoxypyridin-3-yl)-3-(4-(pyridin-3-yl)piperazin-1-yl)indolin-2-one ID: ALA4282776
PubChem CID: 145980454
Max Phase: Preclinical
Molecular Formula: C31H30ClN5O6S
Molecular Weight: 636.13
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)N2C(=O)C(c3cccnc3OC)(N3CCN(c4cccnc4)CC3)c3cc(Cl)ccc32)c(OC)c1
Standard InChI: InChI=1S/C31H30ClN5O6S/c1-41-23-9-11-28(27(19-23)42-2)44(39,40)37-26-10-8-21(32)18-25(26)31(30(37)38,24-7-5-13-34-29(24)43-3)36-16-14-35(15-17-36)22-6-4-12-33-20-22/h4-13,18-20H,14-17H2,1-3H3
Standard InChI Key: OBOOZTGDULABDR-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 49 0 0 0 0 0 0 0 0999 V2000
43.8020 -2.3945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8020 -3.2117 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.5073 -3.6162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2126 -3.2117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2126 -2.3945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.5073 -1.9818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9067 -2.8189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9108 -3.6361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8807 -5.3241 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.1749 -5.7368 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
43.8852 -6.1417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.7219 -3.9002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7208 -4.7197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4288 -5.1287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4271 -3.4913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0141 -3.4918 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
42.1357 -3.8966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1405 -4.7152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9205 -4.9637 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.3979 -4.2985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2150 -4.2937 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.6343 -6.3498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8356 -6.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2926 -6.7918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5495 -7.5684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3544 -7.7320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8940 -7.1210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6950 -7.2828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.9554 -8.0574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0070 -8.1796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.2065 -8.0154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6146 -2.4086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6108 -1.5921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9005 -1.1863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1926 -1.6029 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.1998 -2.4179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4955 -2.8324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.7845 -2.4296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.9215 -1.9880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.6241 -2.4018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.3325 -1.9960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
47.3354 -1.1779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.6239 -0.7674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.9184 -1.1756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
8 7 1 0
10 9 2 0
11 10 2 0
12 13 2 0
13 14 1 0
14 18 2 0
17 15 2 0
15 12 1 0
12 16 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 8 1 0
8 17 1 0
20 21 2 0
19 10 1 0
10 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
27 28 1 0
28 29 1 0
25 30 1 0
30 31 1 0
7 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 7 1 0
36 37 1 0
37 38 1 0
8 2 1 0
5 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 43 1 0
43 44 2 0
44 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 636.13Molecular Weight (Monoisotopic): 635.1605AlogP: 3.96#Rotatable Bonds: 8Polar Surface Area: 114.40Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 5.57CX LogP: 3.99CX LogD: 3.99Aromatic Rings: 4Heavy Atoms: 44QED Weighted: 0.28Np Likeness Score: -1.08
References 1. Geneste H, Bhowmik S, van Gaalen MM, Hornberger W, Hutchins CW, Netz A, Oost T, Unger L.. (2018) Novel, potent, selective and brain penetrant vasopressin 1b receptor antagonists., 28 (19): [PMID:30098866 ] [10.1016/j.bmcl.2018.07.043 ]