The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(ethylsulfonyl)phenyl)-N-(4-(1-(indolin-1-yl)-2-methyl-1-oxopropan-2-yl)phenyl)acetamide ID: ALA4282801
PubChem CID: 145981346
Max Phase: Preclinical
Molecular Formula: C28H30N2O4S
Molecular Weight: 490.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(C(C)(C)C(=O)N3CCc4ccccc43)cc2)cc1
Standard InChI: InChI=1S/C28H30N2O4S/c1-4-35(33,34)24-15-9-20(10-16-24)19-26(31)29-23-13-11-22(12-14-23)28(2,3)27(32)30-18-17-21-7-5-6-8-25(21)30/h5-16H,4,17-19H2,1-3H3,(H,29,31)
Standard InChI Key: GXNJWSJMKRTTPH-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
19.0059 -12.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0100 -13.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7157 -13.1540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6714 -12.8481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.0841 -13.5579 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
26.4925 -12.8456 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7185 -13.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7173 -14.7943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4254 -15.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1350 -14.7938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1322 -13.9712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4236 -13.5659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8434 -15.2013 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.5505 -14.7916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2588 -15.1991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5492 -13.9744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9659 -14.7894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6729 -15.1982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3795 -14.7892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3787 -13.9711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6653 -13.5638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9617 -13.9752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7941 -13.9670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5006 -13.5564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3031 -13.9751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5953 -13.5667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3033 -14.7923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5092 -12.7550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7099 -12.5853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8484 -13.9002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3032 -13.2931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5069 -13.4623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2547 -14.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8049 -14.8448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5992 -14.6725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 2 0
6 5 2 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
10 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
20 5 1 0
5 23 1 0
23 24 1 0
7 2 1 0
2 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 1 0
29 31 1 0
30 26 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.63Molecular Weight (Monoisotopic): 490.1926AlogP: 4.53#Rotatable Bonds: 7Polar Surface Area: 83.55Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.96CX Basic pKa: ┄CX LogP: 4.47CX LogD: 4.47Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.53Np Likeness Score: -1.67
References 1. Sasaki Y, Odan M, Yamamoto S, Kida S, Ueyama A, Shimizu M, Haruna T, Watanabe A, Okuno T.. (2018) Discovery of a potent orally bioavailable retinoic acid receptor-related orphan receptor-gamma-t (RORγt) inhibitor, S18-000003., 28 (22): [PMID:30301676 ] [10.1016/j.bmcl.2018.09.032 ]