2-(4-(ethylsulfonyl)phenyl)-N-(4-(1-(indolin-1-yl)-2-methyl-1-oxopropan-2-yl)phenyl)acetamide

ID: ALA4282801

PubChem CID: 145981346

Max Phase: Preclinical

Molecular Formula: C28H30N2O4S

Molecular Weight: 490.63

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(C(C)(C)C(=O)N3CCc4ccccc43)cc2)cc1

Standard InChI:  InChI=1S/C28H30N2O4S/c1-4-35(33,34)24-15-9-20(10-16-24)19-26(31)29-23-13-11-22(12-14-23)28(2,3)27(32)30-18-17-21-7-5-6-8-25(21)30/h5-16H,4,17-19H2,1-3H3,(H,29,31)

Standard InChI Key:  GXNJWSJMKRTTPH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   19.0059  -12.7490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0100  -13.5662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7157  -13.1540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6714  -12.8481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.0841  -13.5579    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   26.4925  -12.8456    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7185  -13.9748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7173  -14.7943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4254  -15.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1350  -14.7938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1322  -13.9712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4236  -13.5659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8434  -15.2013    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.5505  -14.7916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2588  -15.1991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5492  -13.9744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.9659  -14.7894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6729  -15.1982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3795  -14.7892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3787  -13.9711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6653  -13.5638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9617  -13.9752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7941  -13.9670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5006  -13.5564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3031  -13.9751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5953  -13.5667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.3033  -14.7923    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.5092  -12.7550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7099  -12.5853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8484  -13.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3032  -13.2931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5069  -13.4623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2547  -14.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8049  -14.8448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5992  -14.6725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  2  0
  6  5  2  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 20  5  1  0
  5 23  1  0
 23 24  1  0
  7  2  1  0
  2 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  1  0
 28 29  1  0
 29 31  1  0
 30 26  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4282801

    ---

Associated Targets(Human)

RORC Tchem Nuclear receptor ROR-gamma (8495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rorc Nuclear receptor ROR-gamma (89407 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 490.63Molecular Weight (Monoisotopic): 490.1926AlogP: 4.53#Rotatable Bonds: 7
Polar Surface Area: 83.55Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.96CX Basic pKa: CX LogP: 4.47CX LogD: 4.47
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.53Np Likeness Score: -1.67

References

1. Sasaki Y, Odan M, Yamamoto S, Kida S, Ueyama A, Shimizu M, Haruna T, Watanabe A, Okuno T..  (2018)  Discovery of a potent orally bioavailable retinoic acid receptor-related orphan receptor-gamma-t (RORγt) inhibitor, S18-000003.,  28  (22): [PMID:30301676] [10.1016/j.bmcl.2018.09.032]

Source