The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4282837
PubChem CID: 101999506
Max Phase: Preclinical
Molecular Formula: C28H26N4O5
Molecular Weight: 498.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN[C@@H]1C[C@H]2O[C@@](C)([C@@H]1OC)n1c3ccc(O)cc3c3c4c(c5c6cc(O)ccc6n2c5c31)C(=O)NC4
Standard InChI: InChI=1S/C28H26N4O5/c1-28-26(36-3)17(29-2)10-20(37-28)31-18-6-4-12(33)8-14(18)22-23-16(11-30-27(23)35)21-15-9-13(34)5-7-19(15)32(28)25(21)24(22)31/h4-9,17,20,26,29,33-34H,10-11H2,1-3H3,(H,30,35)/t17-,20-,26-,28+/m1/s1
Standard InChI Key: ZMSQWSOKLIXTQV-FYTWVXJKSA-N
Molfile:
RDKit 2D
38 45 0 0 0 0 0 0 0 0999 V2000
32.2997 -5.7657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0438 -5.1508 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.9795 -5.1384 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.6010 -4.5358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4264 -4.5276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0178 -5.3530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.7195 -5.7781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8309 -3.8136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1800 -3.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4058 -3.0954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5886 -3.0995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2885 -4.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7306 -4.7876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2914 -6.5912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6440 -3.9745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3669 -4.0034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7195 -6.6036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6575 -2.3112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9889 -1.8242 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.0013 -7.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3245 -2.3195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4458 -2.0512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.5031 -5.9762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9931 -7.8252 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.5816 -6.9915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.5374 -5.1632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4818 -5.1260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6901 -3.5247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3043 -3.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7153 -8.2421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8675 -6.5788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1586 -4.6390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0431 -3.8136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8522 -4.6844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9513 -3.8631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5201 -5.9886 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
29.2913 -3.3812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.6951 -3.3209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 7 1 0
4 2 1 0
5 4 1 0
6 1 1 0
7 6 1 0
8 5 2 0
9 4 2 0
10 11 2 0
11 9 1 0
12 2 1 0
13 3 1 0
14 1 1 0
15 13 2 0
16 12 1 0
17 20 1 0
18 10 1 0
19 21 1 0
20 14 1 0
21 11 1 0
22 18 2 0
1 23 1 6
20 24 1 1
14 25 1 1
26 12 2 0
27 13 1 0
28 16 2 0
29 15 1 0
30 24 1 0
31 25 1 0
32 27 2 0
33 32 1 0
34 26 1 0
35 34 2 0
7 36 1 6
7 17 1 0
9 16 1 0
5 3 1 0
8 15 1 0
28 35 1 0
8 10 1 0
18 19 1 0
33 29 2 0
35 37 1 0
33 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.54Molecular Weight (Monoisotopic): 498.1903AlogP: 3.77#Rotatable Bonds: 2Polar Surface Area: 109.91Molecular Species: BASEHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.90CX Basic pKa: 9.89CX LogP: 2.46CX LogD: 1.32Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.30Np Likeness Score: 1.45
References 1. Maruta H, Ahn MR.. (2017) From bench (laboratory) to bed (hospital/home): How to explore effective natural and synthetic PAK1-blockers/longevity-promoters for cancer therapy., 142 [PMID:28814374 ] [10.1016/j.ejmech.2017.07.043 ]