NA

ID: ALA4282837

PubChem CID: 101999506

Max Phase: Preclinical

Molecular Formula: C28H26N4O5

Molecular Weight: 498.54

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN[C@@H]1C[C@H]2O[C@@](C)([C@@H]1OC)n1c3ccc(O)cc3c3c4c(c5c6cc(O)ccc6n2c5c31)C(=O)NC4

Standard InChI:  InChI=1S/C28H26N4O5/c1-28-26(36-3)17(29-2)10-20(37-28)31-18-6-4-12(33)8-14(18)22-23-16(11-30-27(23)35)21-15-9-13(34)5-7-19(15)32(28)25(21)24(22)31/h4-9,17,20,26,29,33-34H,10-11H2,1-3H3,(H,30,35)/t17-,20-,26-,28+/m1/s1

Standard InChI Key:  ZMSQWSOKLIXTQV-FYTWVXJKSA-N

Molfile:  

     RDKit          2D

 38 45  0  0  0  0  0  0  0  0999 V2000
   32.2997   -5.7657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0438   -5.1508    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.9795   -5.1384    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.6010   -4.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4264   -4.5276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0178   -5.3530    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.7195   -5.7781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8309   -3.8136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1800   -3.8218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4058   -3.0954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5886   -3.0995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2885   -4.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7306   -4.7876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2914   -6.5912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6440   -3.9745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3669   -4.0034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7195   -6.6036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6575   -2.3112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9889   -1.8242    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.0013   -7.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3245   -2.3195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4458   -2.0512    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.5031   -5.9762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9931   -7.8252    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5816   -6.9915    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.5374   -5.1632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4818   -5.1260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6901   -3.5247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3043   -3.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7153   -8.2421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8675   -6.5788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1586   -4.6390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0431   -3.8136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8522   -4.6844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9513   -3.8631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5201   -5.9886    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   29.2913   -3.3812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.6951   -3.3209    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  7  1  0
  4  2  1  0
  5  4  1  0
  6  1  1  0
  7  6  1  0
  8  5  2  0
  9  4  2  0
 10 11  2  0
 11  9  1  0
 12  2  1  0
 13  3  1  0
 14  1  1  0
 15 13  2  0
 16 12  1  0
 17 20  1  0
 18 10  1  0
 19 21  1  0
 20 14  1  0
 21 11  1  0
 22 18  2  0
  1 23  1  6
 20 24  1  1
 14 25  1  1
 26 12  2  0
 27 13  1  0
 28 16  2  0
 29 15  1  0
 30 24  1  0
 31 25  1  0
 32 27  2  0
 33 32  1  0
 34 26  1  0
 35 34  2  0
  7 36  1  6
  7 17  1  0
  9 16  1  0
  5  3  1  0
  8 15  1  0
 28 35  1  0
  8 10  1  0
 18 19  1  0
 33 29  2  0
 35 37  1  0
 33 38  1  0
M  END

Associated Targets(Human)

PAK3 Tchem Serine/threonine-protein kinase PAK 3 (1514 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Prkca Protein kinase C (PKC) (359 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 498.54Molecular Weight (Monoisotopic): 498.1903AlogP: 3.77#Rotatable Bonds: 2
Polar Surface Area: 109.91Molecular Species: BASEHBA: 8HBD: 4
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 8.90CX Basic pKa: 9.89CX LogP: 2.46CX LogD: 1.32
Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.30Np Likeness Score: 1.45

References

1. Maruta H, Ahn MR..  (2017)  From bench (laboratory) to bed (hospital/home): How to explore effective natural and synthetic PAK1-blockers/longevity-promoters for cancer therapy.,  142  [PMID:28814374] [10.1016/j.ejmech.2017.07.043]

Source