The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(4-bromophenyl)-3-(2-(2-hydroxyethoxy)ethyl)-7-phenyl-3H-pyrrolo[2,3-d]pyrimidin-4(7H)-one ID: ALA4282891
PubChem CID: 145981816
Max Phase: Preclinical
Molecular Formula: C22H20BrN3O3
Molecular Weight: 454.32
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=c1c2cc(-c3ccc(Br)cc3)n(-c3ccccc3)c2ncn1CCOCCO
Standard InChI: InChI=1S/C22H20BrN3O3/c23-17-8-6-16(7-9-17)20-14-19-21(26(20)18-4-2-1-3-5-18)24-15-25(22(19)28)10-12-29-13-11-27/h1-9,14-15,27H,10-13H2
Standard InChI Key: ZVUYOGCMZKVMGS-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
11.3414 -12.7764 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0510 -12.3670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0482 -11.5443 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3396 -11.1391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6333 -12.3675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6300 -11.5510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8524 -11.3018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3751 -11.9643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8578 -12.6229 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5625 -11.9683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1516 -11.2606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3352 -11.2636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9286 -11.9735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3445 -12.6819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1596 -12.6754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6081 -13.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8081 -13.5716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5586 -14.3489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1081 -14.9550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9103 -14.7783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1561 -14.0012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3369 -10.3219 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7543 -11.1331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4636 -11.5390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1698 -11.1278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8790 -11.5337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5852 -11.1224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2944 -11.5283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1115 -11.9780 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 1 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
8 10 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
9 16 1 0
4 22 2 0
3 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
13 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.32Molecular Weight (Monoisotopic): 453.0688AlogP: 3.63#Rotatable Bonds: 7Polar Surface Area: 69.28Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.16CX LogP: 3.60CX LogD: 3.60Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.43Np Likeness Score: -1.14