The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[4-[2-(Benzoxazol-2-ylthio)ethyl]piperazin-1-yl]-N-(2,4-bis-(methylthio)-6-methyl-3-pyridyl)acetamide ID: ALA4282905
PubChem CID: 22272776
Max Phase: Preclinical
Molecular Formula: C23H29N5O2S3
Molecular Weight: 503.72
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CSc1cc(C)nc(SC)c1NC(=O)CN1CCN(CCSc2nc3ccccc3o2)CC1
Standard InChI: InChI=1S/C23H29N5O2S3/c1-16-14-19(31-2)21(22(24-16)32-3)26-20(29)15-28-10-8-27(9-11-28)12-13-33-23-25-17-6-4-5-7-18(17)30-23/h4-7,14H,8-13,15H2,1-3H3,(H,26,29)
Standard InChI Key: FYLYPENKLITCIZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
3.1518 -3.5081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1506 -4.3276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8587 -4.7366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8569 -3.0992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5655 -3.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5703 -4.3277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3547 -4.5775 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8347 -3.9087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3469 -3.2456 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6519 -3.9038 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.0647 -4.6091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8818 -4.6043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2946 -5.3096 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8862 -6.0160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2955 -6.7192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1131 -6.7186 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5196 -6.0087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1087 -5.2993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5231 -7.4255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3403 -7.4237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7504 -8.1306 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7474 -6.7152 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3433 -8.8391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5278 -8.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1208 -9.5454 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5309 -10.2532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3524 -10.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7557 -9.5405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1248 -10.9623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1193 -8.1299 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.5729 -9.5348 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.9863 -10.2397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3021 -8.1298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
13 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
16 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
26 29 1 0
24 30 1 0
28 31 1 0
31 32 1 0
30 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.72Molecular Weight (Monoisotopic): 503.1483AlogP: 4.32#Rotatable Bonds: 9Polar Surface Area: 74.50Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.10CX Basic pKa: 6.53CX LogP: 3.92CX LogD: 3.86Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.43Np Likeness Score: -1.95
References 1. Shibuya K, Kawamine K, Ozaki C, Ohgiya T, Edano T, Yoshinaka Y, Tsunenari Y.. (2018) Discovery of Clinical Candidate 2-(4-(2-((1 H-Benzo[ d]imidazol-2-yl)thio)ethyl)piperazin-1-yl)- N-(6-methyl-2,4-bis(methylthio)pyridin-3-yl)acetamide Hydrochloride [K-604], an Aqueous-Soluble Acyl-CoA:Cholesterol O-Acyltransferase-1 Inhibitor., 61 (23): [PMID:30433781 ] [10.1021/acs.jmedchem.8b01256 ]