The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-Fluoro-4-((2-isopropyl-6-(pyridin-4-yl)-3H-imidazo[4,5-b]pyridin-7-yl)oxy)phenyl)-1-(4-fluorophenyl)-2-oxo-1,2-dihydropyridine-3-carboxamide ID: ALA4282995
PubChem CID: 145982035
Max Phase: Preclinical
Molecular Formula: C32H24F2N6O3
Molecular Weight: 578.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)c1nc2c(Oc3ccc(NC(=O)c4cccn(-c5ccc(F)cc5)c4=O)cc3F)c(-c3ccncc3)cnc2[nH]1
Standard InChI: InChI=1S/C32H24F2N6O3/c1-18(2)29-38-27-28(24(17-36-30(27)39-29)19-11-13-35-14-12-19)43-26-10-7-21(16-25(26)34)37-31(41)23-4-3-15-40(32(23)42)22-8-5-20(33)6-9-22/h3-18H,1-2H3,(H,37,41)(H,36,38,39)
Standard InChI Key: DBOVETFYSOLQIU-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
28.5507 -13.2442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5496 -14.0638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2576 -14.4727 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.2559 -12.8354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9645 -13.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9693 -14.0593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7493 -14.3077 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.2267 -13.6426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7416 -12.9832 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.2534 -12.0182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.9599 -11.6075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6667 -12.0163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3727 -11.6063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3707 -10.7883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6568 -10.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9537 -10.7943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2431 -10.3908 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.0767 -10.3766 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.7861 -10.7821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4921 -10.3705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7897 -11.5993 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.1988 -10.7772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9042 -10.3662 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.9011 -9.5482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1867 -9.1428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4842 -9.5561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2009 -11.5944 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.6135 -10.7721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6142 -11.5903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3227 -11.9961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0298 -11.5848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0240 -10.7634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3150 -10.3613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7396 -11.9897 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.8429 -12.8358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0438 -13.6378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4566 -14.3430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8462 -12.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1392 -11.6093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4306 -12.0182 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.4334 -12.8396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1410 -13.2442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4483 -12.9277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
4 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
16 17 1 0
14 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 20 2 0
22 27 2 0
23 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
1 35 1 0
8 36 1 0
36 37 1 0
35 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 35 1 0
36 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 578.58Molecular Weight (Monoisotopic): 578.1878AlogP: 6.62#Rotatable Bonds: 7Polar Surface Area: 114.79Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.78CX Basic pKa: 4.47CX LogP: 4.94CX LogD: 4.94Aromatic Rings: 6Heavy Atoms: 43QED Weighted: 0.22Np Likeness Score: -1.48
References 1. Baladi T, Aziz J, Dufour F, Abet V, Stoven V, Radvanyi F, Poyer F, Wu TD, Guerquin-Kern JL, Bernard-Pierrot I, Garrido SM, Piguel S.. (2018) Design, synthesis, biological evaluation and cellular imaging of imidazo[4,5-b]pyridine derivatives as potent and selective TAM inhibitors., 26 (20): [PMID:30309671 ] [10.1016/j.bmc.2018.09.031 ]