The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-Benzyl-4-((cyclohexylmethyl)amino)-2-(propylthio)pteridin-7(8H)-one ID: ALA4283234
PubChem CID: 145980900
Max Phase: Preclinical
Molecular Formula: C23H29N5OS
Molecular Weight: 423.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCSc1nc(NCC2CCCCC2)c2ncc(=O)n(Cc3ccccc3)c2n1
Standard InChI: InChI=1S/C23H29N5OS/c1-2-13-30-23-26-21(25-14-17-9-5-3-6-10-17)20-22(27-23)28(19(29)15-24-20)16-18-11-7-4-8-12-18/h4,7-8,11-12,15,17H,2-3,5-6,9-10,13-14,16H2,1H3,(H,25,26,27)
Standard InChI Key: UVQDXQDUFFYKGA-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
41.0026 -4.0158 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.0015 -4.8353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7095 -5.2443 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.7077 -3.6069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2934 -5.2433 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
39.5860 -4.8342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8780 -5.2422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1706 -4.8331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4163 -4.0122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4151 -4.8373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1252 -5.2487 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.8411 -4.8394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8423 -4.0142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1276 -3.5983 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.5476 -5.2500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.1229 -6.0659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8295 -6.4765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8220 -7.2939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5277 -7.7044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2375 -7.2977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2372 -6.4763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5309 -6.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7053 -2.7897 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.9963 -2.3832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2899 -2.7939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5847 -2.3866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8787 -2.7966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8807 -3.6147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5946 -4.0210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2977 -3.6086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 10 2 0
9 4 2 0
4 1 1 0
2 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
9 10 1 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
12 15 2 0
11 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
4 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 25 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 423.59Molecular Weight (Monoisotopic): 423.2093AlogP: 4.73#Rotatable Bonds: 8Polar Surface Area: 72.70Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.31CX LogP: 5.79CX LogD: 5.79Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.42Np Likeness Score: -1.31
References 1. Li ZH, Zhao TQ, Liu XQ, Zhao B, Wang C, Geng PF, Cao YQ, Fu DJ, Jiang LP, Yu B, Liu HM.. (2018) Synthesis and preliminary antiproliferative activity of new pteridin-7(8H)-one derivatives., 143 [PMID:29113745 ] [10.1016/j.ejmech.2017.10.037 ]